Zaleplon-d5
Names and Identifiers of Zaleplon-d5
CAS Number |
1001083-56-2 |
|---|---|
IUPAC Name |
N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)acetamide |
InChI |
InChI=1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3/i1D3,3D2 |
InChIKey |
HUNXMJYCHXQEGX-WNWXXORZSA-N |
Canonical SMILES |
CCN(C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C#N)C(=O)C |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])N(C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C#N)C(=O)C |
Physical and chemical properties of Zaleplon-d5
Exact Mass |
305.12800 |
|---|---|
LogP |
2.64078 |
Molecular Formula |
C17H15N5O |
Molecular Weight |
305.33400 |
PSA |
74.29000 |
Applications of Zaleplon-d5
Zaleplon-d5 is primarily utilized in research settings, particularly in pharmacokinetic studies and drug metabolism investigations. Its deuterated nature allows for enhanced tracking in biological assays, providing insights into drug behavior and interactions within biological systems. Additionally, it serves as a reference standard in analytical chemistry for testing and validation purposes.
Interaction Studies of Zaleplon-d5
Research indicates that zaleplon-d5 interacts with various central nervous system depressants, similar to its parent compound. Interaction studies focus on its effects when administered alongside other medications, such as benzodiazepines and opioids. These studies are crucial for understanding potential cumulative effects on sedation and respiratory depression.
Biological Activity of Zaleplon-d5
Zaleplon-d5 retains the biological activity characteristic of zaleplon, acting as a positive allosteric modulator at GABA-A receptors. Its rapid absorption and short half-life (approximately 1 hour) make it particularly effective for sleep induction. Studies indicate that zaleplon-d5 may have reduced side effects associated with memory impairment compared to other hypnotics, making it a potentially safer option for patients.