N-(2-Aminoethyl)acetamide
Names and Identifiers of N-(2-Aminoethyl)acetamide
CAS Number |
1001-53-2 |
|---|---|
EC Number |
629-566-2 |
IUPAC Name |
N-(2-aminoethyl)acetamide |
InChI |
InChI=1S/C4H10N2O/c1-4(7)6-3-2-5/h2-3,5H2,1H3,(H,6,7) |
InChIKey |
DAKZISABEDGGSV-UHFFFAOYSA-N |
Canonical SMILES |
CC(=O)NCCN |
UNII |
FQL33V3KZD |
Physical and chemical properties of N-(2-Aminoethyl)acetamide
Acidity coefficient |
15.97±0.46(Predicted) |
|---|---|
Boiling Point |
290.2±23.0 °C at 760 mmHg |
BRN |
1743120 |
Density |
1.0±0.1 g/cm3 |
Exact Mass |
102.079315 |
Flash Point |
129.3±22.6 °C |
Index of Refraction |
1.445 |
LogP |
-1.62 |
Melting Point |
50 °C(lit.) |
Molecular Formula |
C4H10N2O |
Molecular Weight |
102.135 |
PSA |
55.12000 |
Sensitivity |
Hygroscopic |
Solubility |
DMSO (Slightly), Methanol (Slightly) |
Storage condition |
Keep in dark place,Inert atmosphere,Room temperature |
Vapour Pressure |
0.0±0.6 mmHg at 25°C |
Safety Information of N-(2-Aminoethyl)acetamide
Applications of N-(2-Aminoethyl)acetamide
N-(2-Aminoethyl)acetamide finds applications in various fields:
- Pharmaceuticals: It serves as a precursor for synthesizing biologically active compounds.
- Materials Science: Its derivatives are utilized to enhance the properties of polymers and composites, particularly in biomedical applications.
- Agriculture: Some derivatives exhibit antimicrobial properties, making them potential candidates for agricultural applications.
These diverse applications underscore its importance in both research and industrial contexts.
Interaction Studies of N-(2-Aminoethyl)acetamide
Research has demonstrated that N-(2-Aminoethyl)acetamide interacts favorably with various substrates. For example, it forms stable complexes with metal ions and enhances the solubility of other compounds when incorporated into polymer matrices. These interactions are crucial for developing advanced materials with tailored properties for specific applications, such as drug delivery systems and sensors.
Biological Activity of N-(2-Aminoethyl)acetamide
N-(2-Aminoethyl)acetamide exhibits notable biological activities. Research indicates that derivatives of this compound can enhance the solubility and antibacterial properties of chitosan, suggesting its utility in pharmaceutical applications. Additionally, studies have shown that it can improve the stability of perovskite materials used in photodetectors, indicating potential applications in optoelectronic devices.
Physical sample testing spectrum (NMR) of N-(2-Aminoethyl)acetamide
Cas:107-15-3
Cas:141-78-6
Cas:64-19-7
Cas:141-43-5
Cas:75-05-8