L-Alanine-13C3
CAS No.:
100108-77-8
M. Wt:
92.07110
M. Fa:
13C3H7NO2
InChI Key:
QNAYBMKLOCPYGJ-GCCOVPGMSA-N
Names and Identifiers of L-Alanine-13C3
CAS Number |
100108-77-8 |
|---|---|
IUPAC Name |
(2S)-2-amino(1,2,3-13C3)propanoic acid |
InChI |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1 |
InChIKey |
QNAYBMKLOCPYGJ-GCCOVPGMSA-N |
Canonical SMILES |
CC(C(=O)O)N |
Isomeric SMILES |
[13CH3][13C@@H]([13C](=O)O)N |
Physical and chemical properties of L-Alanine-13C3
Exact Mass |
92.05770 |
|---|---|
LogP |
0.11850 |
Melting Point |
314.5ºC (dec.)(lit.) |
Molecular Formula |
13C3H7NO2 |
Molecular Weight |
92.07110 |
optical activity |
[α]25/D +14.5, c = 2 in 1 M HCl |
PSA |
63.32000 |
Solubility |
Aqueous Acid (Slightly), Water (Slightly) |
Storage condition |
Refrigerator |
Safety Information of L-Alanine-13C3
Applications of L-Alanine-13C3
L-Alanine-13C3 has diverse applications across various fields:
- Metabolomics: It is used in studies to trace metabolic pathways and understand cellular metabolism dynamics due to its stable isotope labeling.
- Nuclear Magnetic Resonance (NMR) Studies: The compound serves as a tracer in NMR experiments designed to probe the structure and dynamics of biological macromolecules.
- Biochemical Research: It aids in understanding enzyme kinetics and metabolic regulation in cellular systems.
Biological Activity of L-Alanine-13C3
L-Alanine-13C3 plays a vital role in several biological processes:
Molecular MechanismAt the molecular level, L-Alanine-13C3 interacts with various enzymes and biomolecules. For example, it binds to alanine transaminase, facilitating the transfer of an amino group and influencing amino acid metabolism. This interaction is crucial for maintaining metabolic homeostasis and regulating energy production within cells.
Cas:107-95-9
Cas:79-09-4