Indiplon-d3
Names and Identifiers of Indiplon-d3
CAS Number |
1001083-37-9 |
|---|---|
IUPAC Name |
N-[3-(3-thiophen-2-ylcarbonylpyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-(trideuteriomethyl)ethanamide |
Canonical SMILES |
[2H]C([2H])([2H])N(C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C(=O)C4=CC=CS4)C(=O)C |
Physical and chemical properties of Indiplon-d3
Exact Mass |
376.09900 |
|---|---|
LogP |
3.67150 |
Molecular Formula |
C20H16N4O2S |
Molecular Weight |
376.43200 |
PSA |
95.81000 |
Applications of Indiplon-d3
This compound has potential applications in medicinal chemistry, particularly in drug discovery targeting cancer therapies and other diseases influenced by kinase activity. Its unique structure may allow for selective inhibition of specific pathways, making it a candidate for further development in pharmaceuticals.
Interaction Studies of Indiplon-d3
Interaction studies are crucial for understanding how N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]-N-(trideuteriomethyl)acetamide interacts with biological targets. These studies typically involve:
- Binding Affinity Assays: To determine how effectively the compound binds to its target proteins.
- Cellular Assays: To evaluate the compound's effects on cell viability and proliferation in various cancer cell lines.
- In Vivo Studies: To assess pharmacokinetics and bioavailability in animal models.
Biological Activity of Indiplon-d3
Preliminary studies suggest that N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]-N-(trideuteriomethyl)acetamide exhibits significant biological activity, particularly as an inhibitor of certain protein kinases. Compounds with similar structures have been reported to show anti-cancer properties due to their ability to interfere with cellular signaling pathways. Further research is needed to fully elucidate its pharmacological profile and therapeutic potential.