Ethyl 4-phenylthiazole-5-carboxylate
Names and Identifiers of Ethyl 4-phenylthiazole-5-carboxylate
CAS Number |
99822-80-7 |
|---|---|
EC Number |
811-396-7 |
MDL Number |
MFCD12400736 |
IUPAC Name |
ethyl 4-phenyl-1,3-thiazole-5-carboxylate |
InChI |
InChI=1S/C12H11NO2S/c1-2-15-12(14)11-10(13-8-16-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
InChIKey |
VUBSBLCFFDSRJO-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(=O)C1=C(N=CS1)C2=CC=CC=C2 |
UNSPSC Code |
12352100 |
Physical and chemical properties of Ethyl 4-phenylthiazole-5-carboxylate
Acidity coefficient |
0.29±0.10(Predicted) |
|---|---|
Boiling Point |
390.1±30.0 °C(Predicted) |
Density |
1.216±0.06 g/cm3(Predicted) |
Exact Mass |
233.05100 |
LogP |
2.98680 |
Melting Point |
90 °C |
Molecular Formula |
C12H11NO2S |
Molecular Weight |
233.28600 |
PSA |
67.43000 |
Storage condition |
Sealed in dry,Room Temperature |
Safety Information of Ethyl 4-phenylthiazole-5-carboxylate
Applications of Ethyl 4-phenylthiazole-5-carboxylate
Ethyl 4-phenylthiazole-5-carboxylate has various applications in medicinal chemistry due to its biological activities. It is being explored as a potential therapeutic agent for conditions requiring modulation of enzyme activity or antimicrobial effects. Additionally, its unique structure allows it to serve as a building block for synthesizing more complex pharmaceutical compounds.
Biological Activity of Ethyl 4-phenylthiazole-5-carboxylate
Ethyl 4-phenylthiazole-5-carboxylate exhibits significant biological properties. It has been reported to interact with various enzymes and proteins, influencing their activity. Notably, it can inhibit certain cytochrome P450 enzymes, which are crucial for drug metabolism. The compound also shows antimicrobial activity, which may be attributed to its ability to penetrate bacterial cell membranes and inhibit growth through interactions with bacterial enzymes.
Physical sample testing spectrum (NMR) of Ethyl 4-phenylthiazole-5-carboxylate
Cas:64399-23-1
