Cyclohexanamine, 1-(2-thienyl)-
Names and Identifiers of Cyclohexanamine, 1-(2-thienyl)-
CAS Number |
100133-00-4 |
|---|---|
EC Number |
831-560-1 |
IUPAC Name |
1-thiophen-2-ylcyclohexan-1-amine |
InChI |
InChI=1S/C10H15NS/c11-10(6-2-1-3-7-10)9-5-4-8-12-9/h4-5,8H,1-3,6-7,11H2 |
InChIKey |
UJIKDMHWQDKDPV-UHFFFAOYSA-N |
Canonical SMILES |
C1CCC(CC1)(C2=CC=CS2)N |
Physical and chemical properties of Cyclohexanamine, 1-(2-thienyl)-
Exact Mass |
181.09300 |
|---|---|
LogP |
3.56650 |
Molecular Formula |
C10H15NS |
Molecular Weight |
181.29800 |
PSA |
54.26000 |
Safety Information of Cyclohexanamine, 1-(2-thienyl)-
Applications of Cyclohexanamine, 1-(2-thienyl)-
Cyclohexanamine, 1-(2-thienyl)- has diverse applications:
- Chemical Research: It serves as a building block for synthesizing more complex organic molecules and is utilized as a reagent in various organic reactions.
- Pharmaceutical Development: The compound is being studied for its potential as a pharmaceutical intermediate due to its biological activity.
- Industrial Use: It finds applications in producing specialty chemicals and polymers, contributing to materials science.
Interaction Studies of Cyclohexanamine, 1-(2-thienyl)-
The interaction studies of cyclohexanamine, 1-(2-thienyl)- focus on its binding affinity with various biological targets. These studies are essential for understanding its pharmacological potential and mechanisms of action. The compound's ability to modulate enzyme activity makes it a candidate for further exploration in drug development.
Biological Activity of Cyclohexanamine, 1-(2-thienyl)-
Research indicates that cyclohexanamine, 1-(2-thienyl)- exhibits potential biological activities, particularly in the realms of antimicrobial and anti-inflammatory properties. Its mechanism of action may involve interaction with specific enzymes and receptors, modulating their activity and leading to various therapeutic effects. For instance, it may inhibit enzymes involved in inflammatory pathways, showcasing its potential as an anti-inflammatory agent.
