1-methyl-1H-1,2,4-triazole-5-carbaldehyde
Names and Identifiers of 99651-37-3
CAS Number |
99651-37-3 |
|---|---|
EC Number |
820-070-3 |
MDL Number |
MFCD12400823 |
IUPAC Name |
2-methyl-1,2,4-triazole-3-carbaldehyde |
InChI |
InChI=1S/C4H5N3O/c1-7-4(2-8)5-3-6-7/h2-3H,1H3 |
InChIKey |
OJBNZAZUTPLWDT-UHFFFAOYSA-N |
Canonical SMILES |
CN1C(=NC=N1)C=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 99651-37-3
Acidity coefficient |
1.38±0.10(Predicted) |
|---|---|
Boiling Point |
50-70 °C |
Density |
1.31±0.1 g/cm3(Predicted) |
Exact Mass |
111.04300 |
Molecular Formula |
C4H5N3O |
Molecular Weight |
111.10200 |
PSA |
47.78000 |
Safety Information of 99651-37-3
Applications of 99651-37-3
The applications of 1-methyl-1H-1,2,4-triazole-5-carbaldehyde are diverse:
- Pharmaceuticals: It serves as a building block for synthesizing complex pharmaceutical compounds.
- Agriculture: The compound is utilized in developing agrochemicals due to its biological activity.
- Materials Science: It is used in producing polymers and dyes.
These applications highlight its significance in both research and industry.
Interaction Studies of 99651-37-3
Interaction studies have shown that 1-methyl-1H-1,2,4-triazole-5-carbaldehyde can form stable complexes with metal ions. This property is particularly useful in coordination chemistry where it can act as a ligand. Additionally, its ability to form hydrogen bonds suggests potential interactions with biological macromolecules such as proteins or nucleic acids.
Biological Activity of 99651-37-3
Research indicates that 1-methyl-1H-1,2,4-triazole-5-carbaldehyde exhibits biological activities that may include antimicrobial and antifungal properties. Its structure allows it to interact with biological targets, potentially inhibiting specific enzymes or pathways involved in microbial growth. Studies have shown that compounds in the triazole family can serve as effective enzyme inhibitors, making this compound of interest in medicinal chemistry.
Physical sample testing spectrum (NMR) of 99651-37-3
