5-Methoxy-6-methyl-1H-indazole
CAS No.:
1000343-61-2
M. Wt:
162.189
M. Fa:
C9H10N2O
InChI Key:
RGAHAJHHPKQPOG-UHFFFAOYSA-N
Names and Identifiers of 5-Methoxy-6-methyl-1H-indazole
CAS Number |
1000343-61-2 |
|---|---|
IUPAC Name |
5-methoxy-6-methyl-1H-indazole |
InChI |
InChI=1S/C9H10N2O/c1-6-3-8-7(5-10-11-8)4-9(6)12-2/h3-5H,1-2H3,(H,10,11) |
InChIKey |
RGAHAJHHPKQPOG-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC2=C(C=C1OC)C=NN2 |
Physical and chemical properties of 5-Methoxy-6-methyl-1H-indazole
Boiling Point |
318.3±22.0 °C at 760 mmHg |
|---|---|
Density |
1.2±0.1 g/cm3 |
Exact Mass |
162.079315 |
Flash Point |
116.6±12.6 °C |
Index of Refraction |
1.629 |
LogP |
2.19 |
Molecular Formula |
C9H10N2O |
Molecular Weight |
162.189 |
PSA |
37.91000 |
Storage condition |
2-8°C |
Vapour Pressure |
0.0±0.7 mmHg at 25°C |
Applications of 5-Methoxy-6-methyl-1H-indazole
5-Methoxy-6-methyl-1H-indazole has potential applications across various fields:
- Medicinal Chemistry: Due to its biological activity, it is being explored for use in drug development targeting infectious diseases and cancer.
- Material Science: Its unique chemical properties make it suitable for developing new materials with specific functionalities.
Current research is ongoing to explore its full potential in these areas.
Interaction Studies of 5-Methoxy-6-methyl-1H-indazole
Interaction studies involving 5-Methoxy-6-methyl-1H-indazole focus on understanding its binding affinity to various biological targets. Key areas of investigation include:
- Enzyme Inhibition: Studies assess how this compound interacts with specific enzymes, which could lead to therapeutic applications.
- Receptor Binding: Investigations into how 5-Methoxy-6-methyl-1H-indazole binds to receptors provide insights into its pharmacodynamics and potential side effects.
These studies are crucial for assessing safety and efficacy profiles necessary for clinical applications.
Biological Activity of 5-Methoxy-6-methyl-1H-indazole
Research indicates that 5-Methoxy-6-methyl-1H-indazole exhibits notable biological activities, including:
- Antimicrobial Properties: Preliminary studies suggest that this compound may have antimicrobial effects against various pathogens.
- Anticancer Activity: There is emerging evidence that 5-Methoxy-6-methyl-1H-indazole may inhibit cancer cell proliferation through various mechanisms, potentially making it a candidate for cancer therapy.
- Neuroprotective Effects: Some studies have indicated potential neuroprotective properties, which could be beneficial in treating neurodegenerative diseases.
These activities highlight its relevance in pharmacological research and drug development.