5-Chloro-N2-methylpyridine-2,3-diamine
Names and Identifiers of 5-Chloro-N2-methylpyridine-2,3-diamine
CAS Number |
100114-37-2 |
|---|---|
EC Number |
962-940-6 |
MDL Number |
MFCD07375046 |
IUPAC Name |
5-chloro-2-N-methylpyridine-2,3-diamine |
InChI |
InChI=1S/C6H8ClN3/c1-9-6-5(8)2-4(7)3-10-6/h2-3H,8H2,1H3,(H,9,10) |
InChIKey |
VMWQUMKADFQDBI-UHFFFAOYSA-N |
Canonical SMILES |
CNC1=C(C=C(C=N1)Cl)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 5-Chloro-N2-methylpyridine-2,3-diamine
Exact Mass |
157.04100 |
|---|---|
H Bond Acceptors |
3 |
H Bond Donors |
2 |
LogP |
2.01310 |
Molecular Formula |
C6H8ClN3 |
Molecular Weight |
157.60100 |
PSA |
50.94000 |
Safety Information of 5-Chloro-N2-methylpyridine-2,3-diamine
Applications of 5-Chloro-N2-methylpyridine-2,3-diamine
5-Chloro-N2-methylpyridine-2,3-diamine has potential applications in various fields:
- Pharmaceuticals: As a building block for developing new medications targeting infectious diseases or cancer.
- Agriculture: Used in formulating agrochemicals due to its antimicrobial properties.
- Materials Science: Its ability to form hydrogen bonds makes it useful in creating novel materials with specific mechanical or thermal properties.
Interaction Studies of 5-Chloro-N2-methylpyridine-2,3-diamine
Studies on the interactions of 5-Chloro-N2-methylpyridine-2,3-diamine with biological targets are crucial for understanding its potential therapeutic effects. Investigations into enzyme binding affinities and cellular uptake mechanisms are ongoing. Preliminary data suggest that this compound may interact favorably with certain enzymes involved in metabolic pathways, indicating its potential as a pharmacological agent.
Similar Compounds: ComparisonSeveral compounds share structural similarities with 5-Chloro-N2-methylpyridine-2,3-diamine. Here is a comparison highlighting their uniqueness:
| Compound Name | CAS Number | Key Features |
|---|---|---|
| 5-Bromo-N2-methylpyridine-2,3-diamine | 89415-54-3 | Similar structure but with bromine instead of chlorine. |
| 5-Iodo-N2-methylpyridine-2,3-diamine | Not listed | Iodine substitution; potentially different reactivity profile. |
| N1-(5-Bromopyrid-2-yl)ethane-1,2-diamine | 199522-66-2 | Contains an ethylamine moiety; differing biological activities. |
| 6-Bromo-3-methyl-3H-imidazo[4,5-b]pyridine | 37805-78-0 | Different ring structure; unique biological properties. |
| 5-Bromo-N-methylpyridin-2-amine | 84539-30-0 | Lacks one amino group compared to the target compound. |
Biological Activity of 5-Chloro-N2-methylpyridine-2,3-diamine
Research indicates that compounds similar to 5-Chloro-N2-methylpyridine-2,3-diamine exhibit various biological activities, including:
- Antimicrobial Properties: Derivatives of pyridine with amino substitutions have shown effectiveness against certain bacterial strains.
- Antitumor Activity: Some studies suggest that pyridine derivatives can inhibit cancer cell proliferation.
- Enzyme Inhibition: The compound may interact with specific enzymes, potentially serving as a lead structure for drug development targeting various biological pathways.
Cas:75806-86-9
