5-Bromo-N-ethylpyrazin-2-amine
CAS No.:
1001050-18-5
M. Wt:
202.05200
M. Fa:
C6H8BrN3
InChI Key:
BTOIVOKUYWVHBG-UHFFFAOYSA-N
Names and Identifiers of 5-Bromo-N-ethylpyrazin-2-amine
CAS Number |
1001050-18-5 |
|---|---|
MDL Number |
MFCD09881408 |
IUPAC Name |
5-bromo-N-ethylpyrazin-2-amine |
InChI |
InChI=1S/C6H8BrN3/c1-2-8-6-4-9-5(7)3-10-6/h3-4H,2H2,1H3,(H,8,10) |
InChIKey |
BTOIVOKUYWVHBG-UHFFFAOYSA-N |
Canonical SMILES |
CCNC1=CN=C(Br)C=N1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 5-Bromo-N-ethylpyrazin-2-amine
Exact Mass |
200.99000 |
|---|---|
H Bond Acceptors |
3 |
H Bond Donors |
1 |
LogP |
1.74390 |
Molecular Formula |
C6H8BrN3 |
Molecular Weight |
202.05200 |
PSA |
37.81000 |
Safety Information of 5-Bromo-N-ethylpyrazin-2-amine
Applications of 5-Bromo-N-ethylpyrazin-2-amine
5-bromo-N-ethylpyrazin-2-amine serves as an important intermediate in organic synthesis and medicinal chemistry. Its applications include:
- Pharmaceutical Development: It may be used to synthesize novel drugs targeting various diseases due to its potential biological activity.
- Material Science: Pyrazine derivatives are explored for their electronic properties and may find applications in organic electronics or as ligands in coordination chemistry.
Interaction Studies of 5-Bromo-N-ethylpyrazin-2-amine
Interaction studies involving 5-bromo-N-ethylpyrazin-2-amine focus on its reactivity with various electrophiles and nucleophiles. These interactions are critical for understanding its potential as a building block in drug design and other synthetic applications. Specific studies may include:
- Reactivity Profiles: Evaluating how the presence of the bromine and amino groups affects its reactivity compared to other similar compounds.
- Biological Interactions: Investigating how this compound interacts with biological targets, which could lead to insights into its pharmacological potential.