4-amino-2-chloro-5-methoxybenzoic acid
CAS No.:
1001347-19-8
M. Wt:
201.60700
M. Fa:
C8H8ClNO3
InChI Key:
YHGWZVSXRFBPNJ-UHFFFAOYSA-N
Names and Identifiers of 4-amino-2-chloro-5-methoxybenzoic acid
CAS Number |
1001347-19-8 |
|---|---|
MDL Number |
MFCD24499075 |
IUPAC Name |
4-amino-2-chloro-5-methoxybenzoic acid |
InChI |
InChI=1S/C8H8ClNO3/c1-13-7-2-4(8(11)12)5(9)3-6(7)10/h2-3H,10H2,1H3,(H,11,12) |
InChIKey |
YHGWZVSXRFBPNJ-UHFFFAOYSA-N |
Canonical SMILES |
COC1=CC(C(=O)O)=C(Cl)C=C1N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-amino-2-chloro-5-methoxybenzoic acid
Exact Mass |
201.01900 |
|---|---|
H Bond Acceptors |
4 |
H Bond Donors |
2 |
LogP |
2.21020 |
Molecular Formula |
C8H8ClNO3 |
Molecular Weight |
201.60700 |
PSA |
72.55000 |
Safety Information of 4-amino-2-chloro-5-methoxybenzoic acid
Applications of 4-amino-2-chloro-5-methoxybenzoic acid
4-Amino-2-chloro-5-methoxybenzoic acid has several applications:
- Pharmaceuticals: It serves as an intermediate in the synthesis of various drugs.
- Chemical Research: Utilized in studying reaction mechanisms and developing new synthetic methods.
- Biological Studies: Acts as a probe in biochemical assays to investigate enzyme interactions and metabolic pathways.
Biological Activity of 4-amino-2-chloro-5-methoxybenzoic acid
The biological activity of 4-amino-2-chloro-5-methoxybenzoic acid is primarily attributed to its ability to interact with specific enzymes and receptors. Its structural components allow it to modulate various biochemical pathways, potentially acting as an inhibitor or activator depending on the context of its application. This makes it valuable for studies in pharmacology and biochemistry.
