4-Fluoro-3,5-dimethylphenylacetic acid
CAS No.:
1000544-58-0
M. Wt:
182.19
M. Fa:
C10H11FO2
InChI Key:
KVZWAVFWDGHWDQ-UHFFFAOYSA-N
Appearance:
Solid
Names and Identifiers of 4-Fluoro-3,5-dimethylphenylacetic acid
CAS Number |
1000544-58-0 |
|---|---|
MDL Number |
MFCD09832375 |
IUPAC Name |
2-(4-fluoro-3,5-dimethylphenyl)acetic acid |
InChI |
InChI=1S/C10H11FO2/c1-6-3-8(5-9(12)13)4-7(2)10(6)11/h3-4H,5H2,1-2H3,(H,12,13) |
InChIKey |
KVZWAVFWDGHWDQ-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC(=CC(=C1F)C)CC(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-Fluoro-3,5-dimethylphenylacetic acid
Appearance of Characters |
crystalline powder | Pale yellow |
|---|---|
Molecular Formula |
C10H11FO2 |
Molecular Weight |
182.19 |
Safety Information of 4-Fluoro-3,5-dimethylphenylacetic acid
Applications of 4-Fluoro-3,5-dimethylphenylacetic acid
4-Fluoro-3,5-dimethylphenylacetic acid has potential applications in:
- Pharmaceuticals: As an intermediate in synthesizing drugs due to its biological activity.
- Agricultural Chemicals: Its derivatives may serve as herbicides or fungicides.
- Material Science: Used in developing polymers or other materials where specific chemical properties are required.
The compound's unique structure allows for diverse applications across multiple industries.
Interaction Studies of 4-Fluoro-3,5-dimethylphenylacetic acid
Interaction studies involving 4-fluoro-3,5-dimethylphenylacetic acid focus on its binding affinity and reactivity with various biological targets. Preliminary studies suggest that compounds with similar structures may interact with enzymes or receptors involved in inflammatory pathways. Further investigations are necessary to elucidate its specific interactions and mechanisms of action in biological systems.
