4-Amino-3-hydroxypyridine Sulfate
Names and Identifiers of 4-Amino-3-hydroxypyridine Sulfate
CAS Number |
100130-15-2 |
|---|---|
IUPAC Name |
(4-aminopyridin-3-yl) hydrogen sulfate |
InChI |
InChI=1S/C5H6N2O4S/c6-4-1-2-7-3-5(4)11-12(8,9)10/h1-3H,(H2,6,7)(H,8,9,10) |
InChIKey |
UHYGMFPQJLJNNE-UHFFFAOYSA-N |
Canonical SMILES |
C1=CN=CC(=C1N)OS(=O)(=O)O |
UNII |
G2432XF5PX |
Physical and chemical properties of 4-Amino-3-hydroxypyridine Sulfate
Exact Mass |
190.00500 |
|---|---|
LogP |
1.50740 |
Melting Point |
>155°C (dec.) |
Molecular Formula |
C5H6N2O4S |
Molecular Weight |
190.17700 |
PSA |
110.89000 |
Solubility |
DMF (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
Storage condition |
Hygroscopic, -20°C Freezer, Under inert atmosphere |
Interaction Studies of 4-Amino-3-hydroxypyridine Sulfate
Research indicates that 4-Amino-3-hydroxypyridine Sulfate interacts significantly with acetylcholine receptors, impacting cholinergic signaling pathways. Studies on its binding affinity and effects on neurotransmitter levels provide insights into its potential therapeutic applications in neuromuscular disorders.
Biological Activity of 4-Amino-3-hydroxypyridine Sulfate
4-Amino-3-hydroxypyridine Sulfate primarily targets acetylcholine receptors in cells. Its mechanism of action involves increasing levels of acetylcholine through metabolism by carbamic acid, which enhances muscle contraction. This compound influences the cholinergic pathway, making it significant in studies related to neuromuscular functions.
PharmacokineticsThe pharmacokinetic profile indicates that the compound exhibits a clear dose-proportional response, although environmental factors can affect its stability and efficacy. Optimal storage conditions are recommended at -20°C.