4-(Benzylsulfonyl)butanoic acid
CAS No.:
100059-54-9
M. Wt:
242.29100
M. Fa:
C11H14O4S
InChI Key:
LLDRPAWRVOITSC-UHFFFAOYSA-N
Names and Identifiers of 4-(Benzylsulfonyl)butanoic acid
CAS Number |
100059-54-9 |
|---|---|
MDL Number |
MFCD11987038 |
IUPAC Name |
4-benzylsulfonylbutanoic acid |
InChI |
InChI=1S/C11H14O4S/c12-11(13)7-4-8-16(14,15)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,12,13) |
InChIKey |
LLDRPAWRVOITSC-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C=C1)CS(=O)(=O)CCCC(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-(Benzylsulfonyl)butanoic acid
Exact Mass |
242.06100 |
|---|---|
LogP |
2.54700 |
Molecular Formula |
C11H14O4S |
Molecular Weight |
242.29100 |
PSA |
79.82000 |
Safety Information of 4-(Benzylsulfonyl)butanoic acid
Applications of 4-(Benzylsulfonyl)butanoic acid
4-(Benzylsulfonyl)butanoic acid has potential applications in:
- Pharmaceutical Development: As a precursor or active ingredient in the synthesis of drugs targeting inflammation or bacterial infections.
- Organic Synthesis: Utilized as an intermediate in the synthesis of more complex organic molecules.
- Material Science: Potential use in developing polymers or materials with specific functional properties due to its unique chemical structure.
Interaction Studies of 4-(Benzylsulfonyl)butanoic acid
Interaction studies involving 4-(Benzylsulfonyl)butanoic acid focus on its ability to bind with various biological targets, particularly enzymes involved in inflammatory pathways. Investigating its interactions with proteins could reveal insights into its mechanism of action and therapeutic potential.
