4-(2-Chlorophenyl)piperidine
Names and Identifiers of 4-(2-Chlorophenyl)piperidine
CAS Number |
100129-35-9 |
|---|---|
MDL Number |
MFCD09026406 |
IUPAC Name |
4-(2-chlorophenyl)piperidine |
InChI |
InChI=1S/C11H14ClN/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2 |
InChIKey |
LIQZVQFEBKPDRL-UHFFFAOYSA-N |
Canonical SMILES |
C1CNCCC1C2=CC=CC=C2Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 4-(2-Chlorophenyl)piperidine
Acidity coefficient |
10.09±0.10(Predicted) |
|---|---|
Boiling Point |
276.3°C |
Density |
1.095±0.06 g/cm3(Predicted) |
Exact Mass |
195.08100 |
LogP |
3.13580 |
Molecular Formula |
C11H14ClN |
Molecular Weight |
195.68900 |
PSA |
12.03000 |
Storage condition |
2-8°C |
Safety Information of 4-(2-Chlorophenyl)piperidine
Applications of 4-(2-Chlorophenyl)piperidine
4-(2-Chlorophenyl)piperidine is primarily used in medicinal chemistry for:
- Drug Development: Its structural characteristics make it a valuable scaffold for designing new pharmaceuticals, particularly those targeting neurological and psychiatric disorders.
- Antimicrobial Agents: Due to its biological activity, it is being explored for potential use as an antimicrobial agent.
Interaction Studies of 4-(2-Chlorophenyl)piperidine
Interaction studies involving 4-(2-Chlorophenyl)piperidine have focused on its role as an enzyme inhibitor. Specifically, its inhibition of cytochrome P450 enzymes, particularly CYP2D6, has implications for drug-drug interactions and personalized medicine approaches. Understanding these interactions is crucial for predicting metabolic pathways and optimizing therapeutic regimens involving this compound.
Biological Activity of 4-(2-Chlorophenyl)piperidine
Research indicates that 4-(2-Chlorophenyl)piperidine exhibits significant biological activities, particularly as an inhibitor of certain enzymes. Notably, it has been identified as a CYP2D6 inhibitor, which is crucial for drug metabolism in humans. Additionally, studies have shown that derivatives of piperidine compounds often possess antimicrobial properties, suggesting potential applications in treating infections.
