3-(6-Methylpyridin-2-YL)propan-1-amine
Names and Identifiers of 3-(6-Methylpyridin-2-YL)propan-1-amine
CAS Number |
1000510-50-8 |
|---|---|
EC Number |
871-176-1 |
IUPAC Name |
3-(6-methylpyridin-2-yl)propan-1-amine |
InChI |
InChI=1S/C9H14N2/c1-8-4-2-5-9(11-8)6-3-7-10/h2,4-5H,3,6-7,10H2,1H3 |
InChIKey |
NJCMXCBIYRJQNN-UHFFFAOYSA-N |
Canonical SMILES |
CC1=NC(=CC=C1)CCCN |
Physical and chemical properties of 3-(6-Methylpyridin-2-YL)propan-1-amine
Acidity coefficient |
10.13±0.10(Predicted) |
|---|---|
Boiling Point |
236.7±28.0 °C(Predicted) |
Density |
0.988±0.06 g/cm3(Predicted) |
Safety Information of 3-(6-Methylpyridin-2-YL)propan-1-amine
Applications of 3-(6-Methylpyridin-2-YL)propan-1-amine
3-(6-Methylpyridin-2-YL)propan-1-amine has various applications across multiple fields:
- Chemistry: Serves as a building block for synthesizing more complex organic molecules.
- Biology: Investigated for its potential roles in biological systems and as a ligand in coordination chemistry.
- Medicine: Explored for therapeutic properties, including its use in drug development.
- Industry: Utilized in producing specialty chemicals and as an intermediate in various chemical processes.
Interaction Studies of 3-(6-Methylpyridin-2-YL)propan-1-amine
The interaction studies involving 3-(6-Methylpyridin-2-YL)propan-1-amine focus on its mechanism of action as a ligand binding to specific molecular targets. These interactions can lead to modulation of enzyme activities or receptor functions, influencing various biological processes. Understanding these interactions is crucial for assessing the compound's potential therapeutic uses and mechanisms within biological systems.
Biological Activity of 3-(6-Methylpyridin-2-YL)propan-1-amine
Research suggests that 3-(6-Methylpyridin-2-YL)propan-1-amine may exhibit biological activity through its interactions with specific molecular targets, such as receptors or enzymes. Its potential as a ligand in coordination chemistry and its role in biological systems are areas of ongoing investigation. The compound's unique structure may contribute to its effectiveness in modulating biological pathways, making it a candidate for further study in drug development.