3-(5-Methylthiophen-2-yl)propan-1-amine
Names and Identifiers of 3-(5-Methylthiophen-2-yl)propan-1-amine
CAS Number |
1000530-84-6 |
|---|---|
MDL Number |
MFCD09912908 |
IUPAC Name |
3-(5-methylthiophen-2-yl)propan-1-amine |
InChI |
InChI=1S/C8H13NS/c1-7-4-5-8(10-7)3-2-6-9/h4-5H,2-3,6,9H2,1H3 |
InChIKey |
KXGJHODEJWQRRS-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC=C(S1)CCCN |
UNSPSC Code |
12352100 |
Physical and chemical properties of 3-(5-Methylthiophen-2-yl)propan-1-amine
Exact Mass |
155.07700 |
|---|---|
LogP |
2.64810 |
Molecular Formula |
C8H13NS |
Molecular Weight |
155.26100 |
PSA |
54.26000 |
Safety Information of 3-(5-Methylthiophen-2-yl)propan-1-amine
Applications of 3-(5-Methylthiophen-2-yl)propan-1-amine
3-(5-Methylthiophen-2-yl)propan-1-amine has potential applications in various fields:
- Pharmaceuticals: Due to its structural features, it may serve as a lead compound for developing new medications targeting neurological or infectious diseases.
- Organic Synthesis: It can be utilized as a building block in synthesizing more complex organic molecules, particularly those involving nitrogen and sulfur functionalities.
- Material Science: Its unique properties may lend themselves to applications in developing novel materials with specific electronic or optical characteristics.
These applications highlight the versatility of this compound in both medicinal chemistry and materials science.
Interaction Studies of 3-(5-Methylthiophen-2-yl)propan-1-amine
Interaction studies involving 3-(5-Methylthiophen-2-yl)propan-1-amine focus on its behavior in biological systems and its interactions with other molecules. These studies may include:
- Binding Affinity Assessments: Evaluating how well the compound binds to specific receptors or enzymes.
- Metabolic Pathway Analysis: Investigating how the compound is metabolized within biological systems, which can provide insights into its pharmacokinetics and potential side effects.
Such studies are crucial for understanding the therapeutic potential and safety profile of the compound.
Similar CompoundsSeveral compounds share structural similarities with 3-(5-Methylthiophen-2-yl)propan-1-amine. Here are some notable examples:
| Compound Name | Structural Features |
|---|---|
| 2-(3-Methylthiophen-2-Yl)propan-1-Amine | Contains a methylthiophene group; different position |
| N-Methyl-N-(5-methylthiophen-2-Yl)propanamide | Amide derivative; retains thiophene structure |
| 3-(5-Ethylthiophen-2-Yl)propan-1-Amine | Ethyl substitution on thiophene; similar backbone |
| N,N-Dimethyl(5-methylthiophen-2-Yl)propanamide | Dimethylated amine; retains core structure |
Biological Activity of 3-(5-Methylthiophen-2-yl)propan-1-amine
Research on the biological activity of 3-(5-Methylthiophen-2-yl)propan-1-amine is limited, but compounds with similar structures often exhibit interesting pharmacological properties. Thiophene-containing compounds have been studied for their potential in:
- Antimicrobial Activity: Many thiophene derivatives show effectiveness against various bacterial strains.
- Antidepressant Effects: Some amine derivatives are known to exhibit mood-enhancing properties, suggesting potential applications in treating depression or anxiety disorders.
- Neuroprotective Properties: Certain analogs have been investigated for their neuroprotective effects in models of neurodegenerative diseases.
Further studies are necessary to elucidate the specific biological activities associated with 3-(5-Methylthiophen-2-yl)propan-1-amine.