3,7-Diiodo-1H-indazole
CAS No.:
1000342-61-9
M. Wt:
369.929
M. Fa:
C7H4I2N2
InChI Key:
ILISIMBDPSICGC-UHFFFAOYSA-N
Names and Identifiers of 3,7-Diiodo-1H-indazole
CAS Number |
1000342-61-9 |
|---|---|
MDL Number |
MFCD09880024 |
IUPAC Name |
3,7-diiodo-2H-indazole |
InChI |
InChI=1S/C7H4I2N2/c8-5-3-1-2-4-6(5)10-11-7(4)9/h1-3H,(H,10,11) |
InChIKey |
ILISIMBDPSICGC-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC2=C(NN=C2C(=C1)I)I |
UNSPSC Code |
12352100 |
Physical and chemical properties of 3,7-Diiodo-1H-indazole
Acidity coefficient |
10.08±0.40(Predicted) |
|---|---|
Boiling Point |
434.6±25.0 °C at 760 mmHg |
Density |
2.7±0.1 g/cm3 |
Exact Mass |
369.846375 |
Flash Point |
216.6±23.2 °C |
H Bond Acceptors |
1 |
H Bond Donors |
1 |
Index of Refraction |
1.854 |
LogP |
4.18 |
Molecular Formula |
C7H4I2N2 |
Molecular Weight |
369.929 |
PSA |
28.68000 |
Vapour Pressure |
0.0±1.0 mmHg at 25°C |
Safety Information of 3,7-Diiodo-1H-indazole
Applications of 3,7-Diiodo-1H-indazole
3,7-Diiodo-1H-indazole has several applications in medicinal chemistry and drug development:
- Anticancer Research: Its potential as an anticancer agent makes it valuable in developing new cancer therapies.
- Pharmaceutical Intermediates: It serves as an intermediate in synthesizing other biologically active compounds.
- Chemical Probes: Due to its unique structure, it can be used as a chemical probe in biological studies to understand various biochemical pathways.
Biological Activity of 3,7-Diiodo-1H-indazole
Research indicates that 3,7-diiodo-1H-indazole exhibits significant biological activity. It has been studied for its potential as an anticancer agent, showing efficacy against various cancer cell lines. Additionally, it may possess anti-inflammatory properties and could interact with multiple biological pathways, making it a candidate for further pharmacological studies.
