2-Iodo-4-methylthiopyrimidine
Names and Identifiers of 2-Iodo-4-methylthiopyrimidine
CAS Number |
1000576-08-8 |
|---|---|
EC Number |
825-778-6 |
IUPAC Name |
2-iodo-4-methylsulfanylpyrimidine |
InChI |
InChI=1S/C5H5IN2S/c1-9-4-2-3-7-5(6)8-4/h2-3H,1H3 |
InChIKey |
GBBQPKKFWLPCFM-UHFFFAOYSA-N |
Canonical SMILES |
CSC1=NC(=NC=C1)I |
Physical and chemical properties of 2-Iodo-4-methylthiopyrimidine
Exact Mass |
251.92200 |
|---|---|
LogP |
1.80310 |
Molecular Formula |
C5H5IN2S |
Molecular Weight |
252.07600 |
PSA |
51.08000 |
Safety Information of 2-Iodo-4-methylthiopyrimidine
Applications of 2-Iodo-4-methylthiopyrimidine
2-Iodo-4-methylthiopyrimidine has potential applications in several fields:
- Medicinal Chemistry: Its derivatives may serve as lead compounds in the development of new pharmaceuticals targeting infections or cancer.
- Agricultural Science: Compounds with similar structures are often evaluated for their herbicidal or fungicidal properties, indicating potential utility in crop protection.
- Chemical Biology: It may be used as a biochemical probe in proteomics research due to its unique reactivity.
Interaction Studies of 2-Iodo-4-methylthiopyrimidine
Interaction studies involving 2-iodo-4-methylthiopyrimidine focus on its binding affinity to various biological targets. Preliminary studies suggest that compounds with similar structures can interact with enzymes or receptors involved in metabolic pathways, potentially leading to therapeutic effects. Further investigations are necessary to elucidate the specific interactions and mechanisms of action.
Biological Activity of 2-Iodo-4-methylthiopyrimidine
The biological activity of 2-iodo-4-methylthiopyrimidine has been explored in various contexts. Compounds with similar structures have shown antimicrobial and antiviral properties, making them candidates for pharmaceutical development. The methylthio group is often associated with enhanced biological activity compared to unsubstituted pyrimidines, suggesting that 2-iodo-4-methylthiopyrimidine may exhibit similar or improved efficacy against certain pathogens.
