2-Bromo-4-cyanophenylisothiocyanate
Names and Identifiers of 2-Bromo-4-cyanophenylisothiocyanate
CAS Number |
1000577-91-2 |
|---|---|
MDL Number |
MFCD09800816 |
IUPAC Name |
3-bromo-4-isothiocyanatobenzonitrile |
InChI |
InChI=1S/C8H3BrN2S/c9-7-3-6(4-10)1-2-8(7)11-5-12/h1-3H |
InChIKey |
TXSYSARBLBVCHQ-UHFFFAOYSA-N |
Canonical SMILES |
N#CC1=CC=C(N=C=S)C(Br)=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-Bromo-4-cyanophenylisothiocyanate
Boiling Point |
350.6±32.0 °C(Predicted) |
|---|---|
Density |
1.53±0.1 g/cm3(Predicted) |
Exact Mass |
237.92000 |
LogP |
3.05508 |
Molecular Formula |
C8H3BrN2S |
Molecular Weight |
239.09200 |
PSA |
68.24000 |
Safety Information of 2-Bromo-4-cyanophenylisothiocyanate
Applications of 2-Bromo-4-cyanophenylisothiocyanate
3-Bromo-4-Isothiocyanato-Benzonitrile finds applications primarily in medicinal chemistry, particularly as an intermediate in the synthesis of pharmaceuticals targeting cancer treatment. Its unique structural features allow it to serve as a building block for various bioactive compounds, including potential anti-cancer agents and other therapeutic molecules.
Biological Activity of 2-Bromo-4-cyanophenylisothiocyanate
Research indicates that compounds containing both isothiocyanate and nitrile functionalities exhibit potential biological activities, particularly in the field of cancer research. Isothiocyanates are known for their anticancer properties, potentially aiding in the prevention of prostate cancer through mechanisms involving apoptosis and cell cycle arrest. The specific biological activity of 3-Bromo-4-Isothiocyanato-Benzonitrile has not been extensively documented but can be inferred from similar compounds.
