2-Bromo-1-chloro-3,4,5-trifluorobenzene
CAS No.:
1000577-28-5
M. Wt:
245.424
M. Fa:
C6HBrClF3
InChI Key:
IDWJHPHIYHBSKA-UHFFFAOYSA-N
Names and Identifiers of 2-Bromo-1-chloro-3,4,5-trifluorobenzene
CAS Number |
1000577-28-5 |
|---|---|
MDL Number |
MFCD09800795 |
IUPAC Name |
2-bromo-1-chloro-3,4,5-trifluorobenzene |
InChI |
InChI=1S/C6HBrClF3/c7-4-2(8)1-3(9)5(10)6(4)11/h1H |
InChIKey |
IDWJHPHIYHBSKA-UHFFFAOYSA-N |
Canonical SMILES |
C1=C(C(=C(C(=C1Cl)Br)F)F)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-Bromo-1-chloro-3,4,5-trifluorobenzene
Boiling Point |
186.9±35.0 °C at 760 mmHg |
|---|---|
Density |
1.9±0.1 g/cm3 |
Exact Mass |
243.890213 |
Flash Point |
66.8±25.9 °C |
Index of Refraction |
1.508 |
LogP |
2.41 |
Molecular Formula |
C6HBrClF3 |
Molecular Weight |
245.424 |
Vapour Pressure |
0.9±0.3 mmHg at 25°C |
Safety Information of 2-Bromo-1-chloro-3,4,5-trifluorobenzene
Applications of 2-Bromo-1-chloro-3,4,5-trifluorobenzene
2-Bromo-1-chloro-3,4,5-trifluorobenzene finds applications in various fields:
- Pharmaceuticals: It serves as an intermediate in the synthesis of various pharmaceutical compounds due to its unique structural properties.
- Agricultural Chemicals: Compounds with similar structures are often used in developing pesticides and herbicides.
- Material Science: Used in the synthesis of advanced materials due to its unique electronic properties imparted by the trifluoromethyl groups.
Interaction Studies of 2-Bromo-1-chloro-3,4,5-trifluorobenzene
Interaction studies involving 2-Bromo-1-chloro-3,4,5-trifluorobenzene typically focus on its reactivity with biological molecules or its behavior in different chemical environments. Research indicates that halogenated compounds can influence enzyme activity and receptor binding due to their structural characteristics. Further studies are necessary to elucidate specific interactions with proteins or nucleic acids.
