2-Amino-6-iodophenol
CAS No.:
99968-81-7
M. Wt:
235.02200
M. Fa:
C6H6INO
InChI Key:
WKOJOGYKEWTXHX-UHFFFAOYSA-N
Appearance:
Pale-brown Solid
Names and Identifiers of 2-Amino-6-iodophenol
CAS Number |
99968-81-7 |
|---|---|
MDL Number |
MFCD16999401 |
IUPAC Name |
2-amino-6-iodophenol |
InChI |
InChI=1S/C6H6INO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H,8H2 |
InChIKey |
WKOJOGYKEWTXHX-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C(C(=C1)I)O)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-Amino-6-iodophenol
Acidity coefficient |
8.30±0.10(Predicted) |
|---|---|
Boiling Point |
248.0±30.0 °C(Predicted) |
Density |
2.094±0.06 g/cm3(Predicted) |
Exact Mass |
234.94900 |
H Bond Acceptors |
2 |
H Bond Donors |
2 |
LogP |
2.16020 |
Molecular Formula |
C6H6INO |
Molecular Weight |
235.02200 |
PSA |
46.25000 |
Safety Information of 2-Amino-6-iodophenol
Interaction Studies of 2-Amino-6-iodophenol
The interaction studies of 2-Amino-6-iodophenol have revealed insights into its mechanism of action:
- Enzyme Inhibition: The compound may act as an inhibitor for specific enzymes involved in metabolic pathways, influencing cellular processes and potentially leading to therapeutic effects.
- Molecular Targeting: Its unique structure allows it to form strong interactions with target biomolecules, which is essential for its biological activity.
Further research is needed to fully understand these interactions and their implications for drug development.
Biological Activity of 2-Amino-6-iodophenol
Research indicates that 2-Amino-6-iodophenol exhibits potential biological activities, including:
- Antimicrobial Properties: The compound has been studied for its efficacy against various microbial strains, suggesting potential applications in pharmaceuticals.
- Anticancer Activity: Preliminary studies indicate that 2-Amino-6-iodophenol may possess anticancer properties, although further research is necessary to elucidate its mechanisms of action and effectiveness in cancer treatment.
The presence of the amino group allows for interactions with biological targets, potentially inhibiting specific enzymes or pathways involved in disease processes.
Physical sample testing spectrum (NMR) of 2-Amino-6-iodophenol
