2-[(Propan-2-yloxy)methyl]benzonitrile
Names and Identifiers of 2-[(Propan-2-yloxy)methyl]benzonitrile
CAS Number |
1000931-90-7 |
|---|---|
MDL Number |
MFCD09863327 |
IUPAC Name |
2-(propan-2-yloxymethyl)benzonitrile |
InChI |
InChI=1S/C11H13NO/c1-9(2)13-8-11-6-4-3-5-10(11)7-12/h3-6,9H,8H2,1-2H3 |
InChIKey |
PSOOOXPWTCVNIT-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)OCC1=CC=CC=C1C#N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-[(Propan-2-yloxy)methyl]benzonitrile
Boiling Point |
252.8±15.0 °C(Predicted) |
|---|---|
Density |
1.01±0.1 g/cm3(Predicted) |
H Bond Acceptors |
2 |
H Bond Donors |
0 |
LogP |
2.47850172 |
Molecular Formula |
C11H13NO |
Molecular Weight |
175.23 |
Safety Information of 2-[(Propan-2-yloxy)methyl]benzonitrile
Applications of 2-[(Propan-2-yloxy)methyl]benzonitrile
The applications of 2-[(Propan-2-yloxy)methyl]benzonitrile are diverse:
- Pharmaceuticals: It may serve as a precursor or intermediate in the synthesis of pharmaceutical compounds due to its biological activity.
- Material Science: The compound could be utilized in creating polymers or other materials that require specific functional groups for enhanced properties.
- Chemical Research: Its unique structure makes it valuable for studies in reaction mechanisms and synthetic methodologies.
Interaction Studies of 2-[(Propan-2-yloxy)methyl]benzonitrile
Interaction studies involving 2-[(Propan-2-yloxy)methyl]benzonitrile focus on its binding affinity to various biological targets. Molecular docking simulations have suggested that it may interact with proteins involved in disease processes, indicating its potential as a lead compound in drug discovery. These studies help elucidate its mechanism of action and guide further development.
Biological Activity of 2-[(Propan-2-yloxy)methyl]benzonitrile
Research into the biological activity of 2-[(Propan-2-yloxy)methyl]benzonitrile indicates potential antimicrobial properties. Molecular docking studies suggest that it may interact effectively with biological targets, making it a candidate for further investigation in drug development. Its structure allows for interactions with various enzymes and receptors, indicating possible therapeutic applications.
