2-(Diethoxymethyl)pyrimidine
CAS No.:
1000895-46-4
M. Wt:
182.22000
M. Fa:
C9H14N2O2
InChI Key:
TXBRTFNTEOEZPB-UHFFFAOYSA-N
Names and Identifiers of 2-(Diethoxymethyl)pyrimidine
CAS Number |
1000895-46-4 |
|---|---|
IUPAC Name |
2-(diethoxymethyl)pyrimidine |
InChI |
InChI=1S/C9H14N2O2/c1-3-12-9(13-4-2)8-10-6-5-7-11-8/h5-7,9H,3-4H2,1-2H3 |
InChIKey |
TXBRTFNTEOEZPB-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(C1=NC=CC=N1)OCC |
Physical and chemical properties of 2-(Diethoxymethyl)pyrimidine
Exact Mass |
182.10600 |
|---|---|
LogP |
1.54820 |
Molecular Formula |
C9H14N2O2 |
Molecular Weight |
182.22000 |
PSA |
44.24000 |
Applications of 2-(Diethoxymethyl)pyrimidine
2-(Diethoxymethyl)pyrimidine has potential applications in various fields:
- Pharmaceutical Development: As a building block for drug candidates targeting cancer and infectious diseases.
- Material Science: In the synthesis of polymers or materials with specific electronic properties due to its heterocyclic nature.
- Agricultural Chemistry: Potential use in developing herbicides or fungicides based on its biological activity.
Biological Activity of 2-(Diethoxymethyl)pyrimidine
Research indicates that pyrimidine derivatives, including 2-(Diethoxymethyl)pyrimidine, exhibit a range of biological activities. These compounds have been associated with:
- Antitumor Activity: Many pyrimidine derivatives demonstrate significant antiproliferative effects against various cancer cell lines.
- Antimicrobial Properties: Some studies suggest that these compounds may possess antibacterial and antifungal properties.
- Enzyme Inhibition: Certain derivatives have been evaluated as inhibitors of enzymes such as β-glucuronidase, which is linked to various pathological conditions.
The specific biological activity of 2-(Diethoxymethyl)pyrimidine remains to be fully characterized, but its structural features suggest potential therapeutic applications.