2-(4-Hydroxycyclohexyl)acetic acid
Names and Identifiers of 2-(4-Hydroxycyclohexyl)acetic acid
CAS Number |
99799-09-4 |
|---|---|
EC Number |
878-676-9 |
MDL Number |
MFCD13659403 |
IUPAC Name |
2-(4-hydroxycyclohexyl)acetic acid |
InChI |
InChI=1S/C8H14O3/c9-7-3-1-6(2-4-7)5-8(10)11/h6-7,9H,1-5H2,(H,10,11) |
InChIKey |
ALTAAUJNHYWOGS-UHFFFAOYSA-N |
Canonical SMILES |
C1CC(CCC1CC(=O)O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-(4-Hydroxycyclohexyl)acetic acid
Acidity coefficient |
4.72±0.10(Predicted) |
|---|---|
Boiling Point |
326.439ºC at 760 mmHg |
Density |
1.166 g/cm3 |
Exact Mass |
158.09400 |
Flash Point |
165.436ºC |
LogP |
1.01220 |
Melting Point |
110-120 °C |
Molecular Formula |
C8H14O3 |
Molecular Weight |
158.19500 |
PSA |
57.53000 |
Solubility |
DMSO (Slightly), Methanol (Slightly) |
Storage condition |
Sealed in dry,Room Temperature |
Safety Information of 2-(4-Hydroxycyclohexyl)acetic acid
Interaction Studies of 2-(4-Hydroxycyclohexyl)acetic acid
Interaction studies indicate that 2-(4-Hydroxycyclohexyl)acetic acid can interact with various biological receptors, potentially modulating inflammatory pathways. Its interactions may also extend to enzyme inhibition or activation, contributing to its biological activity. Further pharmacokinetic studies are necessary to elucidate its metabolic pathways and interactions within biological systems.
Biological Activity of 2-(4-Hydroxycyclohexyl)acetic acid
Research indicates that 2-(4-Hydroxycyclohexyl)acetic acid exhibits anti-inflammatory properties, which may be beneficial in treating conditions such as arthritis. Its structural similarity to other biologically active compounds allows it to interact with biological pathways effectively. Additionally, studies suggest potential analgesic effects, although more research is needed to fully understand its mechanisms of action.
Physical sample testing spectrum (NMR) of 2-(4-Hydroxycyclohexyl)acetic acid
Cas:99183-13-8
Cas:52263-23-7