2-(4-Fluoropyridin-2-yl)acetonitrile
Names and Identifiers of 2-(4-Fluoropyridin-2-yl)acetonitrile
CAS Number |
1000504-35-7 |
|---|---|
MDL Number |
MFCD09924401 |
IUPAC Name |
2-(4-fluoropyridin-2-yl)acetonitrile |
InChI |
InChI=1S/C7H5FN2/c8-6-2-4-10-7(5-6)1-3-9/h2,4-5H,1H2 |
InChIKey |
LQGRHTVMEHLBMT-UHFFFAOYSA-N |
Canonical SMILES |
C1=CN=C(C=C1F)CC#N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-(4-Fluoropyridin-2-yl)acetonitrile
Exact Mass |
136.04400 |
|---|---|
LogP |
1.28678 |
Molecular Formula |
C7H5FN2 |
Molecular Weight |
136.12600 |
PSA |
36.68000 |
Storage condition |
under inert gas (nitrogen or Argon) at 2-8°C |
Safety Information of 2-(4-Fluoropyridin-2-yl)acetonitrile
Applications of 2-(4-Fluoropyridin-2-yl)acetonitrile
2-(4-Fluoropyridin-2-yl)acetonitrile finds applications across various fields:
- Pharmaceuticals: It serves as an intermediate in the synthesis of potential drug candidates, particularly those targeting microbial infections or cancer.
- Agrochemicals: The compound is utilized in developing agrochemicals due to its biological activity against pests and pathogens.
- Material Science: It is also explored for its utility in synthesizing materials with specific electronic or optical properties.
Interaction Studies of 2-(4-Fluoropyridin-2-yl)acetonitrile
Studies on 2-(4-Fluoropyridin-2-yl)acetonitrile have focused on its interactions with various biological targets. The fluorine atom's presence modifies the electronic properties of the molecule, affecting how it interacts with enzymes or receptors involved in disease pathways. Research is ongoing to elucidate these interactions further, which could lead to novel therapeutic agents.
Biological Activity of 2-(4-Fluoropyridin-2-yl)acetonitrile
Research indicates that 2-(4-Fluoropyridin-2-yl)acetonitrile possesses notable biological activities. It has been studied for its potential antimicrobial properties and may also exhibit anticancer activity. The mechanism of action involves interactions with specific biological targets, where the electron-withdrawing effect of the fluorine atom can enhance binding affinity and reactivity towards enzymes or receptors. This property makes it a candidate for further exploration in pharmaceutical development.