2-(2-chloro-3-methylphenyl)acetic acid
Names and Identifiers of 2-(2-chloro-3-methylphenyl)acetic acid
CAS Number |
1000518-49-9 |
|---|---|
IUPAC Name |
2-(2-chloranyl-3-methyl-phenyl)ethanoic acid |
Canonical SMILES |
CC1=C(C(=CC=C1)CC(=O)O)Cl |
Physical and chemical properties of 2-(2-chloro-3-methylphenyl)acetic acid
Molecular Formula |
C9H9ClO2 |
|---|---|
Molecular Weight |
184.62 |
Safety Information of 2-(2-chloro-3-methylphenyl)acetic acid
Applications of 2-(2-chloro-3-methylphenyl)acetic acid
2-(2-Chloro-3-methylphenyl)acetic acid has several applications:
- Pharmaceuticals: It serves as an intermediate in the synthesis of various drugs, particularly those targeting inflammatory and pain-related conditions.
- Chemical Research: Used in laboratories for studying reaction mechanisms involving chlorinated compounds.
- Agricultural Chemicals: Potentially utilized in the formulation of herbicides or pesticides due to its chemical properties.
Interaction Studies of 2-(2-chloro-3-methylphenyl)acetic acid
Interaction studies involving 2-(2-Chloro-3-methylphenyl)acetic acid focus on its binding affinity to biological receptors and enzymes. Preliminary studies suggest that it may interact with cyclooxygenase enzymes, which are crucial in the inflammatory response pathway. Understanding these interactions can provide insights into its therapeutic potential and safety profile.
Biological Activity of 2-(2-chloro-3-methylphenyl)acetic acid
The biological activity of 2-(2-Chloro-3-methylphenyl)acetic acid has been explored in various contexts. It is noted for its potential anti-inflammatory properties and may exhibit analgesic effects. Compounds with similar structures often interact with biological pathways related to pain and inflammation, making this compound a candidate for further pharmacological studies.