2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
Names and Identifiers of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
CAS Number |
1000577-84-3 |
|---|---|
IUPAC Name |
2,4-bis(chloranyl)furo[2,3-d]pyrimidine |
Canonical SMILES |
C1=COC2=C1C(=NC(=N2)Cl)Cl |
Physical and chemical properties of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
Acidity coefficient |
-1.28±0.40(Predicted) |
|---|---|
Density |
1.6±0.1 g/cm3 |
Exact Mass |
187.954422 |
Index of Refraction |
1.646 |
LogP |
2.17 |
Molecular Formula |
C6H2Cl2N2O |
Molecular Weight |
188.999 |
PSA |
38.92000 |
Safety Information of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
Applications of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
The applications of 2,4-Dichlorofuro[2,3-D]pyrimidine extend primarily into medicinal chemistry. Its derivatives are being investigated for use as:
- Anticancer Agents: Potential inhibitors of cancer cell growth.
- Antimicrobial Agents: Compounds that may exhibit activity against various pathogens.
- Pharmaceutical Intermediates: Useful in the synthesis of more complex pharmaceutical compounds due to their reactivity.
Interaction Studies of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
Interaction studies have focused on understanding how 2,4-Dichlorofuro[2,3-D]pyrimidine interacts with biological macromolecules. Preliminary studies suggest that it may bind to specific enzymes or receptors involved in cell signaling pathways related to cancer progression and microbial resistance. Further research is required to elucidate these interactions fully and assess their therapeutic implications.
Biological Activity of 2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
Research indicates that 2,4-Dichlorofuro[2,3-D]pyrimidine exhibits notable biological activities, particularly in the realm of anticancer and antimicrobial properties. The compound's structure allows for interactions with biological targets, making it a candidate for further pharmacological studies. Its derivatives have shown promise in inhibiting specific enzymes related to cancer cell proliferation and microbial growth.
