tert-Butyl 4-((5R,7S)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)piperazine-1-carboxylate
Names and Identifiers of 1001201-61-1
CAS Number |
1001201-61-1 |
|---|---|
IUPAC Name |
tert-butyl 4-[(5R,7S)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]piperazine-1-carboxylate |
InChI |
InChI=1S/C17H26N4O3/c1-11-9-12(22)14-13(11)15(19-10-18-14)20-5-7-21(8-6-20)16(23)24-17(2,3)4/h10-12,22H,5-9H2,1-4H3/t11-,12+/m1/s1 |
InChIKey |
FJZNFQTYLHVIML-NEPJUHHUSA-N |
Canonical SMILES |
CC1CC(C2=C1C(=NC=N2)N3CCN(CC3)C(=O)OC(C)(C)C)O |
Isomeric SMILES |
C[C@@H]1C[C@@H](C2=C1C(=NC=N2)N3CCN(CC3)C(=O)OC(C)(C)C)O |
Physical and chemical properties of 1001201-61-1
Exact Mass |
334.20000 |
|---|---|
LogP |
2.07720 |
Molecular Formula |
C17H26N4O3 |
Molecular Weight |
334.41300 |
PSA |
78.79000 |
Storage condition |
2-8°C |
Applications of 1001201-61-1
This compound has potential applications in medicinal chemistry due to its biological activity. It may be utilized in drug development processes targeting diseases such as cancer or inflammatory disorders. Additionally, its unique structure makes it a candidate for further modifications to enhance efficacy or reduce side effects.
Interaction Studies of 1001201-61-1
Interaction studies have shown that tert-butyl 4-((5R,7S)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)piperazine-1-carboxylate interacts with various biological macromolecules, including proteins and enzymes involved in disease pathways. These interactions are crucial for understanding its mechanism of action and optimizing its therapeutic potential.
Biological Activity of 1001201-61-1
Research indicates that tert-butyl 4-((5R,7S)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)piperazine-1-carboxylate exhibits promising biological activities. Specifically, it has been investigated for its potential as an anti-inflammatory and anti-cancer agent. The structural features of this compound may enhance its interaction with biological targets, leading to significant pharmacological effects.