(2-Fluoro-5-methylphenyl)methanesulfonamide
Names and Identifiers of 1001026-55-6
CAS Number |
1001026-55-6 |
|---|---|
IUPAC Name |
(2-fluoro-5-methylphenyl)methanesulfonamide |
InChI |
InChI=1S/C8H10FNO2S/c1-6-2-3-8(9)7(4-6)5-13(10,11)12/h2-4H,5H2,1H3,(H2,10,11,12) |
InChIKey |
JBWVQHBPJCGFMA-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC(=C(C=C1)F)CS(=O)(=O)N |
Physical and chemical properties of 1001026-55-6
Acidity coefficient |
10.17±0.60(Predicted) |
|---|---|
Boiling Point |
353.6±44.0 °C(Predicted) |
Density |
1.346±0.06 g/cm3(Predicted) |
Exact Mass |
203.04200 |
LogP |
2.70370 |
Molecular Formula |
C8H10FNO2S |
Molecular Weight |
203.23400 |
PSA |
68.54000 |
Applications of 1001026-55-6
(2-Fluoro-5-methylphenyl)methanesulfonamide has several potential applications:
- Pharmaceutical Development: Its properties make it suitable for developing drugs aimed at treating infections or inflammatory diseases.
- Biochemical Research: It serves as a tool compound in studying enzyme inhibition mechanisms and metabolic pathways.
- Agricultural Chemistry: There is potential for use in agrochemicals, particularly as a pesticide or herbicide due to its biological activity.
Interaction Studies of 1001026-55-6
Studies have shown that (2-Fluoro-5-methylphenyl)methanesulfonamide interacts with various biological targets. For instance, it has been evaluated for its inhibitory effects on enzymes like autotaxin, which plays a role in inflammatory responses. Understanding these interactions is critical for optimizing its pharmacological profile and therapeutic efficacy.
Biological Activity of 1001026-55-6
Research indicates that (2-Fluoro-5-methylphenyl)methanesulfonamide exhibits significant biological activity. It has been studied for its potential as an inhibitor of various enzymes, including those involved in inflammatory processes. Its sulfonamide structure is known to enhance pharmacokinetic properties, making it a candidate for further exploration in medicinal chemistry.