3-{[(tert-Butoxy)carbonyl](propan-2-yl)amino}-2-(4-chlorophenyl)propanoic acid
CAS No.:
1000985-05-6
M. Wt:
341.83000
M. Fa:
C17H24ClNO4
InChI Key:
GQWRBNJRKSPGTF-UHFFFAOYSA-N
Appearance:
white solid
Names and Identifiers of 1000985-05-6
CAS Number |
1000985-05-6 |
|---|---|
IUPAC Name |
2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]propanoic acid |
InChI |
InChI=1S/C17H24ClNO4/c1-11(2)19(16(22)23-17(3,4)5)10-14(15(20)21)12-6-8-13(18)9-7-12/h6-9,11,14H,10H2,1-5H3,(H,20,21) |
InChIKey |
GQWRBNJRKSPGTF-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)N(CC(C1=CC=C(C=C1)Cl)C(=O)O)C(=O)OC(C)(C)C |
Physical and chemical properties of 1000985-05-6
Exact Mass |
341.13900 |
|---|---|
LogP |
4.15370 |
Molecular Formula |
C17H24ClNO4 |
Molecular Weight |
341.83000 |
PSA |
66.84000 |
Safety Information of 1000985-05-6
Applications of 1000985-05-6
This compound has potential applications in various fields:
- Pharmaceuticals: As a building block in the synthesis of more complex drugs.
- Research: In studies focused on amino acid derivatives and their biological implications.
Its unique structure may also allow for specific interactions in biological systems, making it valuable in drug design.
Biological Activity of 1000985-05-6
While specific biological activities of 3-{amino}-2-(4-chlorophenyl)propanoic acid are not extensively documented, compounds with similar structures often exhibit properties such as:
- Antimicrobial Activity: Many amino acid derivatives show potential as antimicrobial agents.
- Antitumor Activity: Some related compounds have been studied for their effects on cancer cells.
Further research would be necessary to elucidate the specific biological effects of this compound.
