3-((6-Fluoropyridin-2-yl)amino)propan-1-ol
Names and Identifiers of 1000981-38-3
CAS Number |
1000981-38-3 |
|---|---|
MDL Number |
MFCD14600210 |
IUPAC Name |
3-[(6-fluoropyridin-2-yl)amino]propan-1-ol |
InChI |
InChI=1S/C8H11FN2O/c9-7-3-1-4-8(11-7)10-5-2-6-12/h1,3-4,12H,2,5-6H2,(H,10,11) |
InChIKey |
WNCVNUFCEHCFON-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=NC(=C1)F)NCCCO |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000981-38-3
Exact Mass |
170.08600 |
|---|---|
H Bond Acceptors |
3 |
H Bond Donors |
2 |
LogP |
1.08800 |
Molecular Formula |
C8H11FN2O |
Molecular Weight |
170.18400 |
PSA |
45.15000 |
Safety Information of 1000981-38-3
Applications of 1000981-38-3
3-((6-Fluoropyridin-2-yl)amino)propan-1-ol has potential applications in:
- Pharmaceutical Development: Due to its unique structural properties, it may serve as a lead compound in developing new therapeutics targeting specific diseases.
- Chemical Research: Its reactivity allows it to be used in synthesizing more complex molecules for research purposes.
Interaction Studies of 1000981-38-3
Interaction studies have shown that 3-((6-Fluoropyridin-2-yl)amino)propan-1-ol can bind to various biological targets, influencing their function. These studies often involve assessing the compound's binding affinity and selectivity compared to other similar compounds. Understanding these interactions is crucial for elucidating its mechanism of action and potential therapeutic benefits.
Biological Activity of 1000981-38-3
The biological activity of 3-((6-Fluoropyridin-2-yl)amino)propan-1-ol is linked to its interaction with various molecular targets, including enzymes and receptors. The presence of the fluorine atom is known to enhance binding affinity and selectivity toward specific biological targets, which may modulate their activity. Research indicates that compounds with similar structures often exhibit significant pharmacological effects, making this compound a candidate for further investigation in drug discovery.
Cas:1513-65-1
Cas:156-87-6
