1-(pyrrolidin-1-ylsulfonyl)-4,4'-bipiperidine(SALTDATA: FREE)
CAS No.:
1000958-63-3
M. Wt:
301.44800
M. Fa:
C14H27N3O2S
InChI Key:
-
Names and Identifiers of 1000958-63-3
CAS Number |
1000958-63-3 |
|---|---|
IUPAC Name |
4-piperidin-4-yl-1-pyrrolidin-1-ylsulfonyl-piperidine |
Canonical SMILES |
C1CCN(C1)S(=O)(=O)N2CCC(CC2)C3CCNCC3 |
Physical and chemical properties of 1000958-63-3
Exact Mass |
301.18200 |
|---|---|
LogP |
2.32400 |
Molecular Formula |
C14H27N3O2S |
Molecular Weight |
301.44800 |
PSA |
61.03000 |
Applications of 1000958-63-3
1-(Pyrrolidin-1-ylsulfonyl)-4,4'-bipiperidine has potential applications in:
- Medicinal Chemistry: As a lead compound for developing new therapeutic agents targeting various diseases.
- Biochemical Research: In proteomics studies to explore protein interactions and functions.
- Synthetic Chemistry: As an intermediate in the synthesis of other complex molecules due to its reactive functional groups.
Interaction Studies of 1000958-63-3
Interaction studies are crucial for understanding how 1-(Pyrrolidin-1-ylsulfonyl)-4,4'-bipiperidine interacts with biological macromolecules. Preliminary studies suggest that it may bind to specific proteins or enzymes, potentially modulating their activity. These interactions are essential for assessing its viability as a drug candidate and require further exploration through techniques such as affinity chromatography and surface plasmon resonance.