N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethyloxan-4-amine
Names and Identifiers of 100095-38-3
CAS Number |
100095-38-3 |
|---|---|
MDL Number |
MFCD09996875 |
IUPAC Name |
N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethyloxan-4-amine |
InChI |
InChI=1S/C16H25NO2/c1-16(2)12-14(9-11-19-16)17-10-8-13-4-6-15(18-3)7-5-13/h4-7,14,17H,8-12H2,1-3H3 |
InChIKey |
HGHJDDRQDDJMLV-UHFFFAOYSA-N |
Canonical SMILES |
COC1=CC=C(CCNC2CCOC(C)(C)C2)C=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100095-38-3
H Bond Acceptors |
3 |
|---|---|
H Bond Donors |
1 |
LogP |
2.32092237433333 |
Molecular Formula |
C16H25NO2 |
Molecular Weight |
263.37 |
Safety Information of 100095-38-3
Applications of 100095-38-3
N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethyloxan-4-amine has potential applications in:
- Pharmaceutical Development: As a lead compound for developing new analgesics or psychoactive drugs.
- Research: In studies exploring receptor interactions and mechanisms of action related to pain modulation and mood regulation.
Interaction Studies of 100095-38-3
Interaction studies have indicated that this compound may bind to various neurotransmitter receptors, including opioid receptors and other G-protein coupled receptors. These interactions could elucidate its mechanism of action and therapeutic potential. Further studies are required to quantify these interactions and assess their pharmacological relevance.
Biological Activity of 100095-38-3
Preliminary studies suggest that N-[2-(4-methoxyphenyl)ethyl]-2,2-dimethyloxan-4-amine may exhibit significant biological activity, particularly as a ligand for various receptors. Its structural similarity to known opioid receptor ligands indicates potential analgesic properties. Additionally, the compound may interact with other neurotransmitter systems, influencing mood and cognition.
