3-(3-Methyl-5-oxo-4,5-dihydro-1,2-oxazol-4-yl)propanoic acid
CAS No.:
1000933-37-8
M. Wt:
171.15
M. Fa:
C7H9NO4
InChI Key:
DEDBUEJPFDYZIE-UHFFFAOYSA-N
Names and Identifiers of 1000933-37-8
CAS Number |
1000933-37-8 |
|---|---|
EC Number |
833-159-7 |
IUPAC Name |
3-(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)propanoic acid |
InChI |
InChI=1S/C7H9NO4/c1-4-5(2-3-6(9)10)7(11)12-8-4/h5H,2-3H2,1H3,(H,9,10) |
InChIKey |
DEDBUEJPFDYZIE-UHFFFAOYSA-N |
Canonical SMILES |
CC1=NOC(=O)C1CCC(=O)O |
Physical and chemical properties of 1000933-37-8
Molecular Formula |
C7H9NO4 |
|---|---|
Molecular Weight |
171.15 |
Safety Information of 1000933-37-8
Applications of 1000933-37-8
The applications of 3-(3-Methyl-5-oxo-4,5-dihydro-1,2-oxazol-4-yl)propanoic acid are diverse:
- Agriculture: As a herbicide or plant growth regulator.
- Pharmaceuticals: Potential use in drug development due to its biological activities.
Its unique properties make it suitable for further exploration in these fields.
Interaction Studies of 1000933-37-8
Interaction studies have revealed that this compound can interact with various biological targets. Key findings include:
- Binding Affinity: Exhibiting binding to specific enzymes or receptors involved in plant growth regulation or microbial inhibition.
Understanding these interactions is crucial for optimizing its use in practical applications.
Biological Activity of 1000933-37-8
Research indicates that 3-(3-Methyl-5-oxo-4,5-dihydro-1,2-oxazol-4-yl)propanoic acid exhibits notable biological activities. It has been studied for its potential as:
- Antimicrobial agent: Showing efficacy against various bacterial strains.
- Herbicidal properties: Demonstrating activity against specific weed species, making it valuable in agricultural applications.
The compound's unique structure likely contributes to its mode of action in these biological contexts.
