2-{3a-methyl-1,5-dioxo-1H,2H,3H,3aH,4H,5H-pyrrolo[1,2-a]quinazolin-4-yl}acetic acid
CAS No.:
1000933-03-8
M. Wt:
274.27
M. Fa:
C14H14N2O4
InChI Key:
UZCYJZNYWPMFAB-UHFFFAOYSA-N
Names and Identifiers of 1000933-03-8
CAS Number |
1000933-03-8 |
|---|---|
EC Number |
973-360-8 |
IUPAC Name |
2-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)acetic acid |
InChI |
InChI=1S/C14H14N2O4/c1-14-7-6-11(17)16(14)10-5-3-2-4-9(10)13(20)15(14)8-12(18)19/h2-5H,6-8H2,1H3,(H,18,19) |
InChIKey |
UZCYJZNYWPMFAB-UHFFFAOYSA-N |
Canonical SMILES |
CC12CCC(=O)N1C3=CC=CC=C3C(=O)N2CC(=O)O |
Physical and chemical properties of 1000933-03-8
Molecular Formula |
C14H14N2O4 |
|---|---|
Molecular Weight |
274.27 |
Safety Information of 1000933-03-8
Applications of 1000933-03-8
The applications of 2-{3a-methyl-1,5-dioxo-1H,2H,3H,3aH,4H,5H-pyrrolo[1,2-a]quinazolin-4-yl}acetic acid are primarily in medicinal chemistry due to its potential therapeutic effects. Possible applications include:
- Drug Development: As a lead compound for developing new pharmaceuticals targeting cancer or infectious diseases.
- Biochemical Research: Investigating its role in biological systems and pathways.
Interaction Studies of 1000933-03-8
Interaction studies involving 2-{3a-methyl-1,5-dioxo-1H,2H,3H,3aH,4H,5H-pyrrolo[1,2-a]quinazolin-4-yl}acetic acid focus on its binding affinity with various biological targets. These studies may include:
- Enzyme Inhibition Assays: Evaluating the compound's ability to inhibit specific enzymes linked to disease processes.
- Receptor Binding Studies: Assessing how well the compound interacts with cellular receptors.
Such studies are crucial for understanding its pharmacodynamics and potential side effects.
