4-[(2-aminoethyl)sulfamoyl]-1-methyl-1h-pyrrole-2-carboxamide
Names and Identifiers of 1000932-88-6
CAS Number |
1000932-88-6 |
|---|---|
MDL Number |
MFCD09971413 |
IUPAC Name |
4-[(2-aminoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxamide |
InChI |
InChI=1S/C8H14N4O3S/c1-12-5-6(4-7(12)8(10)13)16(14,15)11-3-2-9/h4-5,11H,2-3,9H2,1H3,(H2,10,13) |
InChIKey |
BZDHQNOBMSRBAH-UHFFFAOYSA-N |
Canonical SMILES |
CN1C=C(S(=O)(=O)NCCN)C=C1C(N)=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-88-6
H Bond Acceptors |
4 |
|---|---|
H Bond Donors |
3 |
LogP |
-2.34251443765241 |
Molecular Formula |
C8H14N4O3S |
Molecular Weight |
246.29 |
Safety Information of 1000932-88-6
Applications of 1000932-88-6
The applications of 4-[(2-aminoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxamide are primarily in medicinal chemistry and pharmaceutical development. Potential applications include:
- Antibacterial Agents: Leveraging its sulfonamide structure for developing new antibiotics.
- Anti-inflammatory Drugs: Investigating its effects on inflammatory pathways.
- Research Tools: As a biochemical probe in studies related to enzyme inhibition or receptor binding.
Interaction Studies of 1000932-88-6
Interaction studies involving this compound focus on its binding affinity to various biological targets, including enzymes involved in metabolic pathways and receptors related to inflammation and infection. Understanding these interactions is crucial for elucidating its mechanism of action and optimizing its therapeutic profile.
Biological Activity of 1000932-88-6
4-[(2-aminoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxamide exhibits promising biological activities, particularly due to its sulfonamide component. Sulfonamides are known for their antibacterial effects by inhibiting bacterial folic acid synthesis. Additionally, this compound may exhibit anti-inflammatory properties and could be explored for potential applications in treating conditions such as ulcers or other inflammatory diseases.
