2-{[(difluoromethyl)sulfanyl]methyl}furan-3-carboxylic acid
Names and Identifiers of 1000932-75-1
CAS Number |
1000932-75-1 |
|---|---|
MDL Number |
MFCD09863400 |
IUPAC Name |
2-{[(difluoromethyl)sulfanyl]methyl}furan-3-carboxylic acid |
InChI |
InChI=1S/C7H6F2O3S/c8-7(9)13-3-5-4(6(10)11)1-2-12-5/h1-2,7H,3H2,(H,10,11) |
InChIKey |
WGCGYFVAXAWGDY-UHFFFAOYSA-N |
Canonical SMILES |
O=C(O)C1=C(CSC(F)F)OC=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-75-1
H Bond Acceptors |
2 |
|---|---|
H Bond Donors |
1 |
LogP |
2.465750656 |
Molecular Formula |
C7H6F2O3S |
Molecular Weight |
208.18 |
Safety Information of 1000932-75-1
Applications of 1000932-75-1
2-{[(Difluoromethyl)sulfanyl]methyl}furan-3-carboxylic acid has potential applications in various fields:
- Pharmaceuticals: Due to its unique structure, it may serve as a lead compound in drug discovery.
- Agriculture: Compounds with similar structures are often investigated for use as agrochemicals or pesticides.
- Material Science: Its chemical properties could make it useful in the development of new materials or coatings.
Interaction Studies of 1000932-75-1
Interaction studies for 2-{[(difluoromethyl)sulfanyl]methyl}furan-3-carboxylic acid are essential for understanding its behavior in biological systems and potential therapeutic interactions. Such studies typically involve:
- Binding Affinity: Assessing how well the compound interacts with specific biological targets (e.g., enzymes or receptors).
- Toxicity Testing: Evaluating the safety profile of the compound in various biological models.
- Synergistic Effects: Investigating whether this compound enhances or diminishes the effects of other pharmacological agents.
Biological Activity of 1000932-75-1
While specific biological activity data for 2-{[(difluoromethyl)sulfanyl]methyl}furan-3-carboxylic acid is limited, compounds containing furan rings and sulfur functionalities are often studied for their pharmacological properties. Many furan derivatives exhibit anti-inflammatory, antimicrobial, and anticancer activities. Thus, it is plausible that this compound may possess similar biological properties, warranting further research into its potential therapeutic applications.
