2-[(2-oxopyrrolidin-1-yl)methyl]benzonitrile
Names and Identifiers of 1000932-70-6
CAS Number |
1000932-70-6 |
|---|---|
MDL Number |
MFCD09863395 |
IUPAC Name |
2-[(2-oxopyrrolidin-1-yl)methyl]benzonitrile |
InChI |
InChI=1S/C12H12N2O/c13-8-10-4-1-2-5-11(10)9-14-7-3-6-12(14)15/h1-2,4-5H,3,6-7,9H2 |
InChIKey |
CMNFBCHXBLLJOB-UHFFFAOYSA-N |
Canonical SMILES |
N#CC1=CC=CC=C1CN1CCCC1=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-70-6
H Bond Acceptors |
2 |
|---|---|
H Bond Donors |
0 |
LogP |
1.224636073 |
Molecular Formula |
C12H12N2O |
Molecular Weight |
200.2409973 |
Safety Information of 1000932-70-6
Applications of 1000932-70-6
The primary applications of 2-[(2-Oxopyrrolidin-1-yl)methyl]benzonitrile lie in medicinal chemistry and drug development. Its derivatives are being explored for:
- Pharmaceutical Development: As potential candidates for treating diseases related to hormonal imbalances or muscle degeneration.
- Research Tools: For studying receptor interactions and biochemical pathways in various biological systems.
Interaction Studies of 1000932-70-6
Research indicates that compounds similar to 2-[(2-Oxopyrrolidin-1-yl)methyl]benzonitrile may interact with androgen receptors and other molecular targets. These interactions can lead to significant biological effects, including modulation of gene expression related to muscle growth and metabolism. Understanding these interactions is crucial for developing effective therapeutics based on this compound's structure.
Biological Activity of 1000932-70-6
Compounds similar to 2-[(2-Oxopyrrolidin-1-yl)methyl]benzonitrile have been shown to exhibit various biological activities. These may include interactions with receptors and enzymes that influence cellular pathways. Specifically, derivatives of this compound have been investigated for their potential as selective androgen receptor modulators (SARMs), which could lead to therapeutic applications in conditions like muscle wasting and hormone-related disorders.
