(2e)-3-[4-(cyclopropylcarbamoyl)phenyl]prop-2-enoic acid
CAS No.:
1000932-52-4
M. Wt:
231.25
M. Fa:
C13H13NO3
InChI Key:
FFXXWFKUBVGRPU-FPYGCLRLSA-N
Names and Identifiers of 1000932-52-4
CAS Number |
1000932-52-4 |
|---|---|
MDL Number |
MFCD09863377 |
IUPAC Name |
(2E)-3-[4-(cyclopropylcarbamoyl)phenyl]prop-2-enoic acid |
InChI |
InChI=1S/C13H13NO3/c15-12(16)8-3-9-1-4-10(5-2-9)13(17)14-11-6-7-11/h1-5,8,11H,6-7H2,(H,14,17)(H,15,16)/b8-3+ |
InChIKey |
FFXXWFKUBVGRPU-FPYGCLRLSA-N |
Canonical SMILES |
O=C(O)/C=C/C1=CC=C(C(=O)NC2CC2)C=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-52-4
Acidity coefficient |
-95.54±0.10(Predicted) |
|---|---|
Boiling Point |
484.1±28.0 °C(Predicted) |
Density |
1.29±0.1 g/cm3(Predicted) |
H Bond Acceptors |
3 |
H Bond Donors |
2 |
LogP |
1.67596715666667 |
Molecular Formula |
C13H13NO3 |
Molecular Weight |
231.25 |
Safety Information of 1000932-52-4
Interaction Studies of 1000932-52-4
Studies on the interactions of 3-[4-(Cyclopropylcarbamoyl)phenyl]prop-2-enoic acid with biological targets are ongoing. Its unique structural features may allow it to bind effectively to specific enzymes or receptors, influencing various metabolic pathways. Understanding these interactions could lead to advancements in drug development and therapeutic applications.
Biological Activity of 1000932-52-4
Research indicates that 3-[4-(Cyclopropylcarbamoyl)phenyl]prop-2-enoic acid exhibits potential biological activities. It is being investigated for its anti-inflammatory and anticancer properties. The cyclopropylcarbamoyl group may enhance its binding affinity to specific molecular targets, allowing it to interact with enzymes or receptors involved in various biochemical pathways.
