4-(4-methylpiperazine-1-carbonyl)benzonitrile
Names and Identifiers of 1000932-49-9
CAS Number |
1000932-49-9 |
|---|---|
IUPAC Name |
4-(4-methylpiperazin-1-yl)carbonylbenzenecarbonitrile |
Canonical SMILES |
CN1CCN(CC1)C(=O)C2=CC=C(C=C2)C#N |
Physical and chemical properties of 1000932-49-9
Exact Mass |
229.12200 |
|---|---|
LogP |
0.82168 |
Molecular Formula |
C13H15N3O |
Molecular Weight |
229.27800 |
PSA |
47.34000 |
Safety Information of 1000932-49-9
Interaction Studies of 1000932-49-9
Interaction studies involving 4-(4-Methylpiperazine-1-carbonyl)benzonitrile focus on its binding affinity to various biological targets such as enzymes or receptors. Techniques like molecular docking simulations and binding assays are commonly employed to elucidate these interactions. Understanding these interactions is crucial for determining the pharmacodynamics and pharmacokinetics of the compound, which can inform its development as a therapeutic agent .
Biological Activity of 1000932-49-9
Research indicates that 4-(4-Methylpiperazine-1-carbonyl)benzonitrile exhibits potential biological activities, particularly in antimicrobial and anticancer domains. The piperazine ring is often associated with enhanced binding affinity to various biological targets, including receptors and enzymes. Studies suggest that compounds with similar structures may exhibit significant antitumor and antimicrobial properties, making this compound a candidate for further pharmacological exploration .
