7-cyclopropyl-2,4-dioxo-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-5-carboxylic acid
CAS No.:
1000932-48-8
M. Wt:
289.29
M. Fa:
C14H15N3O4
InChI Key:
LMQJCPFFNQYZOC-UHFFFAOYSA-N
Names and Identifiers of 1000932-48-8
CAS Number |
1000932-48-8 |
|---|---|
MDL Number |
MFCD09863374 |
IUPAC Name |
7-cyclopropyl-2,4-dioxo-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-5-carboxylic acid |
InChI |
InChI=1S/C14H15N3O4/c1-2-5-17-11-10(12(18)16-14(17)21)8(13(19)20)6-9(15-11)7-3-4-7/h6-7H,2-5H2,1H3,(H,19,20)(H,16,18,21) |
InChIKey |
LMQJCPFFNQYZOC-UHFFFAOYSA-N |
Canonical SMILES |
CCCN1C(=O)NC(=O)C2=C(C(=O)O)C=C(C3CC3)N=C21 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-48-8
Density |
1.416±0.06 g/cm3(Predicted) |
|---|---|
H Bond Acceptors |
5 |
H Bond Donors |
2 |
LogP |
1.43587839866667 |
Molecular Formula |
C14H15N3O4 |
Molecular Weight |
289.29 |
Safety Information of 1000932-48-8
Applications of 1000932-48-8
The applications of 7-cyclopropyl-2,4-dioxo-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-5-carboxylic acid span several fields:
- Pharmaceutical Development: As a potential lead compound for drug discovery targeting various diseases.
- Biochemical Research: Utilized in studies exploring receptor modulation and enzyme inhibition.
- Material Science: Investigated for its properties in developing new materials with specific functionalities.
Interaction Studies of 1000932-48-8
Interaction studies involving 7-cyclopropyl-2,4-dioxo-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-5-carboxylic acid focus on its binding affinity and activity towards specific biological targets. These studies often employ techniques such as:
- Molecular Docking: To predict how the compound interacts with target proteins.
- In Vitro Assays: To evaluate biological activity against cell lines or microbial strains.
Such studies help elucidate the mechanism of action and potential therapeutic applications.
