![structure of 5-(CHLOROMETHYL)-7-ETHOXY-2-(TRIFLUOROMETHYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE](https://molwiki.oss-cn-hongkong.aliyuncs.com/structure/47/1000932-47-7.svg)
5-(CHLOROMETHYL)-7-ETHOXY-2-(TRIFLUOROMETHYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE
Names and Identifiers of 1000932-47-7
CAS Number |
1000932-47-7 |
|---|---|
MDL Number |
MFCD09863447 |
IUPAC Name |
5-(chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
InChI |
InChI=1S/C9H8ClF3N4O/c1-2-18-6-3-5(4-10)14-8-15-7(9(11,12)13)16-17(6)8/h3H,2,4H2,1H3 |
InChIKey |
UWWZKZDMXKQKPF-UHFFFAOYSA-N |
Canonical SMILES |
CCOC1=CC(CCl)=NC2=NC(C(F)(F)F)=NN12 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-47-7
H Bond Acceptors |
4 |
|---|---|
H Bond Donors |
0 |
LogP |
2.87332744433333 |
Molecular Formula |
C9H8ClF3N4O |
Molecular Weight |
280.63 |
Safety Information of 1000932-47-7
Applications of 1000932-47-7
This compound has several applications in medicinal chemistry and pharmacological research. Its ability to modulate cellular signaling pathways makes it a candidate for developing anticancer agents. Furthermore, its unique structure allows for exploration in drug design against various diseases beyond cancer, potentially including anti-inflammatory and antimicrobial applications.
Interaction Studies of 1000932-47-7
Studies on the interaction of 5-(Chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine with biological macromolecules have revealed its capacity to bind with specific enzymes and proteins. It has been reported to interact with tubulin and other cellular targets that are crucial for cell division and survival. Such interactions are essential for understanding its pharmacodynamics and therapeutic potential.
Similar Compounds: ComparisonSeveral compounds share structural similarities with 5-(Chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine. Here are a few notable examples:
| Compound Name | Structure | Key Features |
|---|---|---|
| 7-Chloro-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine | Exhibits similar biological activity but with a methyl group instead of an ethoxy group. | |
| 7-Ethoxy-[1,2,4]triazolo[1,5-a]pyrimidine | N/A | Lacks the chloromethyl group but retains the ethoxy moiety; potential for different reactivity. |
| Alkoxy-substituted triazolo-pyrimidines | N/A | General class of compounds that may exhibit herbicidal properties; variations in substituents affect activity profiles. |
Biological Activity of 1000932-47-7
5-(Chloromethyl)-7-ethoxy-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine exhibits significant biological activity, particularly in cancer research. It has been shown to inhibit cell proliferation and induce apoptosis in various cancer cell lines, including MGC-803, HCT-116, and MCF-7 cells. The mechanism of action involves interference with the extracellular signal-regulated kinase (ERK) signaling pathway, leading to decreased phosphorylation levels of key proteins involved in cell survival and proliferation.