5-{[(Difluoromethyl)sulfanyl]methyl}furan-2-carboxylic acid
CAS No.:
1000932-45-5
M. Wt:
208.18
M. Fa:
C7H6F2O3S
InChI Key:
QUJDUFZQRQXIQK-UHFFFAOYSA-N
Names and Identifiers of 1000932-45-5
CAS Number |
1000932-45-5 |
|---|---|
IUPAC Name |
5-(difluoromethylsulfanylmethyl)furan-2-carboxylic acid |
InChI |
InChI=1S/C7H6F2O3S/c8-7(9)13-3-4-1-2-5(12-4)6(10)11/h1-2,7H,3H2,(H,10,11) |
InChIKey |
QUJDUFZQRQXIQK-UHFFFAOYSA-N |
Canonical SMILES |
C1=C(OC(=C1)C(=O)O)CSC(F)F |
Physical and chemical properties of 1000932-45-5
Acidity coefficient |
3.14±0.10(Predicted) |
|---|---|
Boiling Point |
317.4±42.0 °C(Predicted) |
Density |
1.457±0.06 g/cm3(Predicted) |
Molecular Formula |
C7H6F2O3S |
Molecular Weight |
208.18 |
Safety Information of 1000932-45-5
Applications of 1000932-45-5
5-{[(Difluoromethyl)sulfanyl]methyl}furan-2-carboxylic acid has potential applications in various fields:
- Pharmaceuticals: Due to its unique structure, it may serve as a lead compound in drug discovery efforts targeting various diseases.
- Agriculture: Compounds with similar structures have been explored for use as agrochemicals or pesticides.
- Material Science: Its properties could be harnessed in developing new materials or coatings.
Interaction Studies of 1000932-45-5
Interaction studies involving 5-{[(difluoromethyl)sulfanyl]methyl}furan-2-carboxylic acid could focus on its binding affinity with biological macromolecules, such as proteins or nucleic acids. Investigations into its mechanism of action could reveal insights into how it affects cellular pathways or interacts with specific enzymes or receptors.
