4-{[(difluoromethyl)sulfanyl]methyl}benzoic acid
CAS No.:
1000932-37-5
M. Wt:
218.22
M. Fa:
C9H8F2O2S
InChI Key:
ZEUCHMOFBNVMSA-UHFFFAOYSA-N
Names and Identifiers of 1000932-37-5
CAS Number |
1000932-37-5 |
|---|---|
MDL Number |
MFCD09863443 |
IUPAC Name |
4-{[(difluoromethyl)sulfanyl]methyl}benzoic acid |
InChI |
InChI=1S/C9H8F2O2S/c10-9(11)14-5-6-1-3-7(4-2-6)8(12)13/h1-4,9H,5H2,(H,12,13) |
InChIKey |
ZEUCHMOFBNVMSA-UHFFFAOYSA-N |
Canonical SMILES |
O=C(O)C1=CC=C(CSC(F)F)C=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-37-5
H Bond Acceptors |
2 |
|---|---|
H Bond Donors |
1 |
LogP |
3.561411472 |
Molecular Formula |
C9H8F2O2S |
Molecular Weight |
218.22 |
Safety Information of 1000932-37-5
Applications of 1000932-37-5
4-{[(difluoromethyl)sulfanyl]methyl}benzoic acid finds applications in various domains:
- Medicinal Chemistry: It serves as a building block for developing potential pharmaceutical agents due to its unique chemical properties.
- Chemical Research: Used as an intermediate in organic synthesis for creating more complex molecules.
- Material Science: Potential applications in developing new materials with specific properties due to its structural characteristics.
Interaction Studies of 1000932-37-5
Interaction studies involving 4-{[(difluoromethyl)sulfanyl]methyl}benzoic acid may focus on its reactivity with biological macromolecules such as proteins and nucleic acids. These studies can provide insights into its potential therapeutic effects or toxicity profiles. Understanding these interactions is crucial for assessing the safety and efficacy of compounds derived from this structure.
