4-Chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde
CAS No.:
1000932-30-8
M. Wt:
239.67800
M. Fa:
C10H6ClNO2S
InChI Key:
MWDMJNZOVXEWSU-UHFFFAOYSA-N
Names and Identifiers of 1000932-30-8
CAS Number |
1000932-30-8 |
|---|---|
IUPAC Name |
4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde |
InChI |
InChI=1S/C10H6ClNO2S/c11-9-8(6-13)15-10(12-9)14-7-4-2-1-3-5-7/h1-6H |
InChIKey |
MWDMJNZOVXEWSU-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C=C1)OC2=NC(=C(S2)C=O)Cl |
Physical and chemical properties of 1000932-30-8
Exact Mass |
238.98100 |
|---|---|
LogP |
3.40130 |
Molecular Formula |
C10H6ClNO2S |
Molecular Weight |
239.67800 |
PSA |
67.43000 |
Safety Information of 1000932-30-8
Applications of 1000932-30-8
4-Chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde finds applications in various fields:
- Pharmaceuticals: As a potential lead compound for developing new antimicrobial agents.
- Agriculture: May be utilized as a pesticide or fungicide due to its biological activity.
- Chemical Research: Serves as an intermediate in organic synthesis for producing more complex molecules.
Interaction Studies of 1000932-30-8
Interaction studies involving 4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde focus on its binding affinity to biological targets. These studies often employ techniques such as:
- Molecular Docking: To predict how the compound interacts with specific proteins or enzymes.
- In vitro Assays: To assess the biological efficacy and mechanism of action against microbial strains.
Biological Activity of 1000932-30-8
Research indicates that 4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde exhibits significant biological activities, particularly in antimicrobial and antifungal domains. Its structural features suggest potential interactions with biological targets, making it a candidate for further pharmacological studies. Specific activities include:
- Antimicrobial Properties: Exhibits effectiveness against various bacterial strains.
- Antifungal Activity: Shows promise in inhibiting fungal growth, possibly through disruption of cellular processes.
Cas:108-95-2
Cas:92972-48-0
