2-[(5-methyl-1,3-thiazol-2-yl)sulfanyl]-1-thiophen-2-ylethanone
Names and Identifiers of 1000932-25-1
CAS Number |
1000932-25-1 |
|---|---|
IUPAC Name |
2-[(5-methyl-1,3-thiazol-2-yl)sulfanyl]-1-thiophen-2-yl-ethanone |
Canonical SMILES |
CC1=CN=C(S1)SCC(=O)C2=CC=CS2 |
Physical and chemical properties of 1000932-25-1
Molecular Formula |
C10H9NOS3 |
|---|---|
Molecular Weight |
255.4 |
Applications of 1000932-25-1
This compound has a wide range of applications across various fields:
- Chemistry: Serves as a building block for synthesizing more complex molecules.
- Biology: Investigated for potential antimicrobial and antifungal applications.
- Medicine: Explored for anticancer properties and as a drug candidate.
- Industry: Utilized in developing new materials and as a catalyst in
Interaction Studies of 1000932-25-1
Studies on the interactions of 2-[(5-Methyl-1,3-thiazol-2-yl)sulfanyl]-1-(thiophen-2-yl)ethan-1-one with biological targets have indicated promising results. For instance, docking studies have shown that certain derivatives interact effectively with tubulin, which is critical for cell division and cancer proliferation. Such interactions may play a significant role in its potential anticancer activity.
Similar Compounds: Comparison with Other CompoundsSimilar CompoundsThe following compounds share structural similarities with 2-[(5-Methyl-1,3-thiazol-2-yl)sulfanyl]-1-(thiophen-2-yl)ethan-1-one:
- 2-Methylthiazole: Known for its flavor and fragrance properties.
- Thiophene-2-carbaldehyde: Used in synthesizing various heterocyclic compounds.
- 5-Methyl-1,3-thiazol-2-amine: A precursor in synthesizing thiazole derivatives.
What sets 2-[(5-Methyl-1,3-thiazol-2-yl)sulfanyl]-1-(thiophen-2-yl)ethan-1-one apart is its unique combination of thiazole and thiophene rings. This dual functionality confers distinctive chemical reactivity and biological activity that are not present in the similar compounds listed above. As such, it stands out as a versatile compound in both synthetic and medicinal chemistry.
Biological Activity of 1000932-25-1
2-[(5-Methyl-1,3-thiazol-2-yl)sulfanyl]-1-(thiophen-2-yl)ethan-1-one has shown potential biological activities. Research indicates that compounds with similar structures exhibit antimicrobial and antifungal properties. Additionally, this compound is being explored for its anticancer properties and as a potential drug candidate, particularly due to its ability to inhibit growth in various cancer cell lines.