methyl 1-{1-azabicyclo[2.2.2]octan-3-yl}-2,5-dimethyl-1H-pyrrole-3-carboxylate
CAS No.:
1000932-03-5
M. Wt:
262.35
M. Fa:
C15H22N2O2
InChI Key:
-
Names and Identifiers of 1000932-03-5
CAS Number |
1000932-03-5 |
|---|---|
IUPAC Name |
methyl 1-(1-azabicyclo[2.2.2]octan-3-yl)-2,5-dimethyl-pyrrole-3-carboxylate |
Canonical SMILES |
CC1=CC(=C(N1C2CN3CCC2CC3)C)C(=O)OC |
Physical and chemical properties of 1000932-03-5
Molecular Formula |
C15H22N2O2 |
|---|---|
Molecular Weight |
262.35 |
Applications of 1000932-03-5
Methyl 1-{1-azabicyclo[2.2.2]octan-3-yl}-2,5-dimethyl-1H-pyrrole-3-carboxylate has potential applications in various fields:
- Pharmaceuticals: As a candidate for drug development targeting pain relief or anesthesia.
- Chemical Research: Useful in studies related to heterocyclic chemistry and the development of new synthetic methodologies.
Interaction Studies of 1000932-03-5
Research into the interactions of methyl 1-{1-azabicyclo[2.2.2]octan-3-yl}-2,5-dimethyl-1H-pyrrole-3-carboxylate with biological targets is crucial for understanding its pharmacodynamics:
- Receptor Binding Studies: Investigations into how this compound binds to specific receptors (e.g., sodium channels) can elucidate its mechanism of action as an anesthetic or analgesic agent.
Biological Activity of 1000932-03-5
This compound exhibits significant biological activity, particularly in pharmacological contexts. Its structural features suggest potential applications as:
- Local Anesthetics: Similar compounds have shown efficacy in blocking nerve conduction, indicating that methyl 1-{1-azabicyclo[2.2.2]octan-3-yl}-2,5-dimethyl-1H-pyrrole-3-carboxylate could be explored for local anesthetic properties.
- Antinociceptive Agents: The compound may also possess analgesic properties, making it relevant for pain management therapies.