4-(chlorosulfonyl)-1-methyl-1H-pyrrole-2-carboxylic acid
CAS No.:
1000932-01-3
M. Wt:
223.63
M. Fa:
C6H6ClNO4S
InChI Key:
POMZQIUIOJIHIN-UHFFFAOYSA-N
Names and Identifiers of 1000932-01-3
CAS Number |
1000932-01-3 |
|---|---|
EC Number |
848-519-9 |
MDL Number |
MFCD09863423 |
IUPAC Name |
4-chlorosulfonyl-1-methylpyrrole-2-carboxylic acid |
InChI |
InChI=1S/C6H6ClNO4S/c1-8-3-4(13(7,11)12)2-5(8)6(9)10/h2-3H,1H3,(H,9,10) |
InChIKey |
POMZQIUIOJIHIN-UHFFFAOYSA-N |
Canonical SMILES |
CN1C=C(C=C1C(=O)O)S(=O)(=O)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000932-01-3
Acidity coefficient |
3.10±0.41(Predicted) |
|---|---|
Boiling Point |
426.4±30.0 °C(Predicted) |
Density |
1.65±0.1 g/cm3(Predicted) |
Molecular Formula |
C6H6ClNO4S |
Molecular Weight |
223.63 |
Safety Information of 1000932-01-3
Applications of 1000932-01-3
4-(Chlorosulfonyl)-1-methyl-1H-pyrrole-2-carboxylic acid finds applications primarily in polymer chemistry and catalysis:
- Polymer Chemistry: It serves as a chemical reagent in catalyzing living radical polymerizations, enabling controlled growth of polymer chains with specific properties.
- Catalysis: The compound is also utilized in preparing polymer-bound transfer hydrogenation catalysts, which are useful in various organic transformations.
Biological Activity of 1000932-01-3
Currently, there is insufficient scientific research available to definitively characterize the biological activity of 4-(chlorosulfonyl)-1-methyl-1H-pyrrole-2-carboxylic acid. While its structural components suggest potential biological interactions, particularly due to the reactive nature of the chlorosulfonyl group, no comprehensive studies have documented its mechanism of action or specific biological effects within living systems.
