1-Methyl-4-sulfamoyl-1h-pyrrole-2-carboxamide
CAS No.:
1000931-97-4
M. Wt:
203.22
M. Fa:
C6H9N3O3S
InChI Key:
FPFGZTIXKKCTRV-UHFFFAOYSA-N
Names and Identifiers of 1000931-97-4
CAS Number |
1000931-97-4 |
|---|---|
MDL Number |
MFCD09863334 |
IUPAC Name |
1-methyl-4-sulfamoyl-1H-pyrrole-2-carboxamide |
InChI |
InChI=1S/C6H9N3O3S/c1-9-3-4(13(8,11)12)2-5(9)6(7)10/h2-3H,1H3,(H2,7,10)(H2,8,11,12) |
InChIKey |
FPFGZTIXKKCTRV-UHFFFAOYSA-N |
Canonical SMILES |
CN1C=C(S(N)(=O)=O)C=C1C(N)=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000931-97-4
H Bond Acceptors |
3 |
|---|---|
H Bond Donors |
2 |
LogP |
-1.346521818 |
Molecular Formula |
C6H9N3O3S |
Molecular Weight |
203.22 |
Safety Information of 1000931-97-4
Applications of 1000931-97-4
1-Methyl-4-sulfamoyl-1H-pyrrole-2-carboxamide has several applications:
- Medicinal Chemistry: It serves as an intermediate in synthesizing more complex organic molecules and is explored for drug development due to its unique structure.
- Biological Research: Investigated for its potential effects on various biological targets, including enzymes and receptors .
- Specialty Chemicals Production: Used in creating specialized materials and chemicals in industrial settings .
Interaction Studies of 1000931-97-4
The compound's interaction with biological molecules is significant for its mechanism of action. The sulfamoyl group can engage in hydrogen bonding with specific targets, potentially influencing their activity. This interaction may modulate enzyme functions or receptor activities, leading to various biological effects .
Biological Activity of 1000931-97-4
Research indicates that 1-methyl-4-sulfamoyl-1H-pyrrole-2-carboxamide exhibits potential biological activities, including:
- Antimicrobial Properties: The compound has been investigated for its effectiveness against various microbial strains.
- Anticancer Activity: Preliminary studies suggest it may have anticancer properties, making it a candidate for further drug development .